8-[3-(5,7-Dihydroxy-4-oxochromen-2-yl)-5-hydroxyphenyl]-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one
Internal ID | cad5f2cd-3d6d-4c0a-a0c2-a962fd9ecbed |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
IUPAC Name | 8-[3-(5,7-dihydroxy-4-oxochromen-2-yl)-5-hydroxyphenyl]-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
SMILES (Canonical) | C1=CC(=C(C=C1C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)C4=CC(=CC(=C4)C5=CC(=O)C6=C(C=C(C=C6O5)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)C4=CC(=CC(=C4)C5=CC(=O)C6=C(C=C(C=C6O5)O)O)O)O)O |
InChI | InChI=1S/C30H18O11/c31-15-4-13(25-10-22(38)28-19(35)7-16(32)8-26(28)40-25)3-14(5-15)27-20(36)9-21(37)29-23(39)11-24(41-30(27)29)12-1-2-17(33)18(34)6-12/h1-11,31-37H |
InChI Key | VCSJCNFXKCLEQR-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H18O11 |
Molecular Weight | 554.50 g/mol |
Exact Mass | 554.08491139 g/mol |
Topological Polar Surface Area (TPSA) | 194.00 Ų |
XlogP | 4.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.20% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.21% | 91.49% |
CHEMBL3194 | P02766 | Transthyretin | 96.00% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.23% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.79% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 92.90% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.56% | 95.56% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 88.45% | 98.35% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.19% | 94.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.22% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.27% | 94.73% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 85.90% | 96.12% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.85% | 90.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.22% | 99.23% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.01% | 91.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.71% | 86.33% |
CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 81.59% | 91.73% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 80.42% | 83.10% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 80.34% | 91.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Anacardium humile |
PubChem | 162988143 |
LOTUS | LTS0171032 |
wikiData | Q105283928 |