[(2R,3R,3aR,4S,7S,7aR)-7,7a-dimethyl-4'-methylidene-3-(2-methylpropanoyloxy)-2'-oxospiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-4-yl] 3-methylbutanoate
Internal ID | 3e275310-cf48-4454-8398-065e910bc22c |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | [(2R,3R,3aR,4S,7S,7aR)-7,7a-dimethyl-4'-methylidene-3-(2-methylpropanoyloxy)-2'-oxospiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-4-yl] 3-methylbutanoate |
SMILES (Canonical) | CC1CCC(C2C1(CC3(C2OC(=O)C(C)C)C(=C)COC3=O)C)OC(=O)CC(C)C |
SMILES (Isomeric) | C[C@H]1CC[C@@H]([C@H]2[C@@]1(C[C@]3([C@@H]2OC(=O)C(C)C)C(=C)COC3=O)C)OC(=O)CC(C)C |
InChI | InChI=1S/C24H36O6/c1-13(2)10-18(25)29-17-9-8-15(5)23(7)12-24(16(6)11-28-22(24)27)20(19(17)23)30-21(26)14(3)4/h13-15,17,19-20H,6,8-12H2,1-5,7H3/t15-,17-,19+,20+,23+,24+/m0/s1 |
InChI Key | QPPZUSYMBUPRGY-ZMLBSWEPSA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H36O6 |
Molecular Weight | 420.50 g/mol |
Exact Mass | 420.25118886 g/mol |
Topological Polar Surface Area (TPSA) | 78.90 Ų |
XlogP | 4.50 |
There are no found synonyms. |
![2D Structure of [(2R,3R,3aR,4S,7S,7aR)-7,7a-dimethyl-4'-methylidene-3-(2-methylpropanoyloxy)-2'-oxospiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-4-yl] 3-methylbutanoate 2D Structure of [(2R,3R,3aR,4S,7S,7aR)-7,7a-dimethyl-4'-methylidene-3-(2-methylpropanoyloxy)-2'-oxospiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-4-yl] 3-methylbutanoate](https://plantaedb.com/storage/docs/compounds/2023/11/85232780-85e1-11ee-8a91-03e40990c460.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.48% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.17% | 98.95% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 93.95% | 96.47% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.93% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.91% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.03% | 97.25% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 90.72% | 96.77% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.30% | 97.09% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.88% | 91.19% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.34% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.71% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.49% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.48% | 100.00% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 82.34% | 97.79% |
CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 82.23% | 92.95% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 81.88% | 92.78% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.54% | 92.62% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.40% | 94.33% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.88% | 96.21% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.66% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Petasites formosanus |
PubChem | 10717025 |
LOTUS | LTS0121321 |
wikiData | Q105225531 |