(1R,2S,3S,6S,7R)-2-(hydroxymethyl)-3-[(2Z)-1-hydroxy-6-methylhepta-2,5-dien-2-yl]-6-methylbicyclo[4.3.1]decane-1,7-diol
| Internal ID | bdc50cdc-2e89-46ba-98f4-d0d0704b2842 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Bicyclic monoterpenoids |
| IUPAC Name | (1R,2S,3S,6S,7R)-2-(hydroxymethyl)-3-[(2Z)-1-hydroxy-6-methylhepta-2,5-dien-2-yl]-6-methylbicyclo[4.3.1]decane-1,7-diol |
| SMILES (Canonical) | CC(=CCC=C(CO)C1CCC2(CC(C1CO)(CCC2O)O)C)C |
| SMILES (Isomeric) | CC(=CC/C=C(\CO)/[C@H]1CC[C@]2(C[C@@]([C@@H]1CO)(CC[C@H]2O)O)C)C |
| InChI | InChI=1S/C20H34O4/c1-14(2)5-4-6-15(11-21)16-7-9-19(3)13-20(24,17(16)12-22)10-8-18(19)23/h5-6,16-18,21-24H,4,7-13H2,1-3H3/b15-6+/t16-,17-,18-,19+,20-/m1/s1 |
| InChI Key | ZYMMUFSCBCLCRW-AFYYASCASA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24570956 g/mol |
| Topological Polar Surface Area (TPSA) | 80.90 Ų |
| XlogP | 3.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.91% | 83.82% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.78% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.82% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.08% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.99% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.37% | 100.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.18% | 96.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.63% | 94.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.68% | 98.95% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.91% | 95.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.86% | 95.89% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 81.88% | 95.93% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.60% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 21774656 |
| LOTUS | LTS0026418 |
| wikiData | Q105386260 |