5-Hydroxy-8-[5-(5-hydroxy-7-methoxy-4-oxo-2,3-dihydrochromen-2-yl)-2-methoxyphenyl]-2-(4-hydroxyphenyl)-7-methoxychromen-4-one
| Internal ID | 12333ab4-5d56-43ed-b99a-511d64a26858 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
| IUPAC Name | 5-hydroxy-8-[5-(5-hydroxy-7-methoxy-4-oxo-2,3-dihydrochromen-2-yl)-2-methoxyphenyl]-2-(4-hydroxyphenyl)-7-methoxychromen-4-one |
| SMILES (Canonical) | COC1=C(C=C(C=C1)C2CC(=O)C3=C(C=C(C=C3O2)OC)O)C4=C(C=C(C5=C4OC(=CC5=O)C6=CC=C(C=C6)O)O)OC |
| SMILES (Isomeric) | COC1=C(C=C(C=C1)C2CC(=O)C3=C(C=C(C=C3O2)OC)O)C4=C(C=C(C5=C4OC(=CC5=O)C6=CC=C(C=C6)O)O)OC |
| InChI | InChI=1S/C33H26O10/c1-39-19-11-21(35)31-22(36)13-27(42-29(31)12-19)17-6-9-25(40-2)20(10-17)30-28(41-3)15-24(38)32-23(37)14-26(43-33(30)32)16-4-7-18(34)8-5-16/h4-12,14-15,27,34-35,38H,13H2,1-3H3 |
| InChI Key | VZNIORDYCPRTLH-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C33H26O10 |
| Molecular Weight | 582.60 g/mol |
| Exact Mass | 582.15259702 g/mol |
| Topological Polar Surface Area (TPSA) | 141.00 Ų |
| XlogP | 5.70 |
| There are no found synonyms. |
![2D Structure of 5-Hydroxy-8-[5-(5-hydroxy-7-methoxy-4-oxo-2,3-dihydrochromen-2-yl)-2-methoxyphenyl]-2-(4-hydroxyphenyl)-7-methoxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/84db07d0-862e-11ee-859a-172cf28b20bc.jpg "2D Structure of 5-Hydroxy-8-[5-(5-hydroxy-7-methoxy-4-oxo-2,3-dihydrochromen-2-yl)-2-methoxyphenyl]-2-(4-hydroxyphenyl)-7-methoxychromen-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.96% | 94.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.94% | 91.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 96.16% | 99.15% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 96.00% | 98.35% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 95.93% | 96.21% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.72% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.62% | 85.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.58% | 89.00% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 93.76% | 95.78% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.16% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.91% | 97.09% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 91.57% | 88.48% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.97% | 95.89% |
| CHEMBL3194 | P02766 | Transthyretin | 90.84% | 90.71% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.68% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.57% | 86.33% |
| CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 89.95% | 97.03% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.39% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.84% | 99.17% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 87.54% | 86.92% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 87.48% | 92.68% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.54% | 90.00% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.01% | 91.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.62% | 94.45% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.36% | 97.14% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 84.55% | 85.11% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 83.62% | 95.12% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.62% | 98.75% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.05% | 96.95% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 82.30% | 96.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.53% | 90.71% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 81.45% | 95.53% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.06% | 93.99% |
| CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 80.77% | 89.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Selaginella delicatula |
| PubChem | 163013360 |
| LOTUS | LTS0262489 |
| wikiData | Q105299874 |