(1S,3R,8R,11S,12S,15R,16R)-15-[(3R,5S,6S)-5-hydroxy-6-(2-hydroxypropan-2-yl)oxan-3-yl]-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-one
| Internal ID | 56ccf85b-c155-4bef-8062-f833462796b8 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cycloartanols and derivatives |
| IUPAC Name | (1S,3R,8R,11S,12S,15R,16R)-15-[(3R,5S,6S)-5-hydroxy-6-(2-hydroxypropan-2-yl)oxan-3-yl]-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-one |
| SMILES (Canonical) | CC1(C2CCC3C4(CCC(C4(CCC35C2(C5)CCC1=O)C)C6CC(C(OC6)C(C)(C)O)O)C)C |
| SMILES (Isomeric) | C[C@]12CC[C@@]34C[C@@]35CCC(=O)C([C@@H]5CC[C@H]4[C@@]1(CC[C@@H]2[C@H]6C[C@@H]([C@H](OC6)C(C)(C)O)O)C)(C)C |
| InChI | InChI=1S/C30H48O4/c1-25(2)21-7-8-22-28(6)11-9-19(18-15-20(31)24(34-16-18)26(3,4)33)27(28,5)13-14-30(22)17-29(21,30)12-10-23(25)32/h18-22,24,31,33H,7-17H2,1-6H3/t18-,19+,20-,21-,22-,24-,27+,28-,29+,30-/m0/s1 |
| InChI Key | YEENJEQGAWLURT-CEFGYFKCSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C30H48O4 |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.35526001 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 6.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.42% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.05% | 91.11% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.54% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.35% | 95.56% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 89.87% | 95.00% |
| CHEMBL204 | P00734 | Thrombin | 89.50% | 96.01% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.26% | 97.09% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.60% | 82.69% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.37% | 96.95% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.08% | 96.77% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 83.96% | 89.34% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 83.33% | 83.57% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.84% | 92.94% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.72% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 122179257 |
| LOTUS | LTS0190655 |
| wikiData | Q105347188 |