(3R)-7-[(1S,3R)-3-ethoxy-7-methoxy-2,3-dihydro-1H-inden-1-yl]-3-hydroxy-3-methyl-2,4-dihydronaphthalen-1-one
| Internal ID | 5f898ddf-2ca4-4d1b-aa85-0375753b730e |
| Taxonomy | Benzenoids > Tetralins |
| IUPAC Name | (3R)-7-[(1S,3R)-3-ethoxy-7-methoxy-2,3-dihydro-1H-inden-1-yl]-3-hydroxy-3-methyl-2,4-dihydronaphthalen-1-one |
| SMILES (Canonical) | CCOC1CC(C2=C1C=CC=C2OC)C3=CC4=C(CC(CC4=O)(C)O)C=C3 |
| SMILES (Isomeric) | CCO[C@@H]1C[C@H](C2=C1C=CC=C2OC)C3=CC4=C(C[C@@](CC4=O)(C)O)C=C3 |
| InChI | InChI=1S/C23H26O4/c1-4-27-21-11-18(22-16(21)6-5-7-20(22)26-3)14-8-9-15-12-23(2,25)13-19(24)17(15)10-14/h5-10,18,21,25H,4,11-13H2,1-3H3/t18-,21+,23+/m0/s1 |
| InChI Key | RSHNJIADZFGREQ-QTGUNEKASA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.18310931 g/mol |
| Topological Polar Surface Area (TPSA) | 55.80 Ų |
| XlogP | 3.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.11% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.90% | 85.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.37% | 97.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.12% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.51% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.25% | 86.33% |
| CHEMBL240 | Q12809 | HERG | 93.74% | 89.76% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.64% | 95.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.14% | 97.25% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.11% | 95.89% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.10% | 92.62% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.00% | 82.69% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.84% | 92.94% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.74% | 98.75% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 86.24% | 94.03% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.60% | 97.14% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 84.87% | 93.31% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 83.95% | 97.05% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.07% | 89.62% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.96% | 96.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.82% | 94.45% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.55% | 96.38% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.24% | 99.17% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.72% | 95.89% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.20% | 96.21% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.96% | 93.99% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.87% | 100.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.63% | 94.00% |
| CHEMBL2319 | P06870 | Kallikrein 1 | 80.27% | 90.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163163197 |
| LOTUS | LTS0090569 |
| wikiData | Q105244654 |