9,10-Dihydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadec-13-ene-7,15-dione
Internal ID | aadfe57f-e0fb-4deb-9c7a-95c85f18b9cb |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
IUPAC Name | 9,10-dihydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadec-13-ene-7,15-dione |
SMILES (Canonical) | CC1(C=CC(=O)C23C1C(C(C45C2CCC(C4)C(=C)C5=O)(OC3)O)O)C |
SMILES (Isomeric) | CC1(C=CC(=O)C23C1C(C(C45C2CCC(C4)C(=C)C5=O)(OC3)O)O)C |
InChI | InChI=1S/C20H24O5/c1-10-11-4-5-12-18-9-25-20(24,19(12,8-11)15(10)22)16(23)14(18)17(2,3)7-6-13(18)21/h6-7,11-12,14,16,23-24H,1,4-5,8-9H2,2-3H3 |
InChI Key | RTIKCEKESDRWAE-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H24O5 |
Molecular Weight | 344.40 g/mol |
Exact Mass | 344.16237386 g/mol |
Topological Polar Surface Area (TPSA) | 83.80 Ų |
XlogP | 1.10 |
(1S,2S,5R,8S,9S,10S,11R)-9,10-dihydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.1^{5,8.0^{1,11.0^{2,8]octadec-13-ene-7,15-dione |
9,10-Dihydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadec-13-ene-7,15-dione |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.36% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.91% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 89.30% | 98.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.58% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.09% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.07% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.03% | 94.45% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.18% | 92.94% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.54% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.40% | 96.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.07% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.75% | 97.14% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 83.75% | 91.49% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.64% | 96.77% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 80.94% | 85.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.83% | 90.17% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.22% | 94.75% |
CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 80.01% | 80.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Isodon eriocalyx |
PubChem | 3807588 |
LOTUS | LTS0106643 |
wikiData | Q105245163 |