(2S,3R,4S,5R)-2-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-2-[(1R,2S,4S,5'R,6R,7S,8R,9S,12S,13R,16S,18S,19S)-16-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-19-yl]oxy-6-methyloxan-4-yl]oxyoxane-3,4,5-triol
Internal ID | ea86bca6-72fd-433a-b0bd-ad3f78648a8c |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2S,3R,4S,5R)-2-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-2-[(1R,2S,4S,5'R,6R,7S,8R,9S,12S,13R,16S,18S,19S)-16-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-19-yl]oxy-6-methyloxan-4-yl]oxyoxane-3,4,5-triol |
SMILES (Canonical) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC(C6C5(CCC(C6)O)C)OC7C(C(C(C(O7)C)O)OC8C(C(C(CO8)O)O)O)O)C)C)OC1 |
SMILES (Isomeric) | C[C@@H]1CC[C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4C[C@@H]([C@@H]6[C@@]5(CC[C@@H](C6)O)C)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)C)O)O[C@H]8[C@@H]([C@H]([C@@H](CO8)O)O)O)O)C)C)OC1 |
InChI | InChI=1S/C38H62O12/c1-17-6-11-38(46-15-17)18(2)28-27(50-38)14-23-21-13-26(24-12-20(39)7-9-36(24,4)22(21)8-10-37(23,28)5)48-35-32(44)33(29(41)19(3)47-35)49-34-31(43)30(42)25(40)16-45-34/h17-35,39-44H,6-16H2,1-5H3/t17-,18+,19-,20+,21-,22+,23+,24-,25-,26+,27+,28+,29-,30+,31-,32-,33+,34+,35+,36-,37+,38-/m1/s1 |
InChI Key | SZRYARBVBSFVQW-BJSVOLHCSA-N |
Popularity | 3 references in papers |
Molecular Formula | C38H62O12 |
Molecular Weight | 710.90 g/mol |
Exact Mass | 710.42412741 g/mol |
Topological Polar Surface Area (TPSA) | 177.00 Ų |
XlogP | 2.50 |
There are no found synonyms. |
![2D Structure of (2S,3R,4S,5R)-2-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-2-[(1R,2S,4S,5'R,6R,7S,8R,9S,12S,13R,16S,18S,19S)-16-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-19-yl]oxy-6-methyloxan-4-yl]oxyoxane-3,4,5-triol 2D Structure of (2S,3R,4S,5R)-2-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-2-[(1R,2S,4S,5'R,6R,7S,8R,9S,12S,13R,16S,18S,19S)-16-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-19-yl]oxy-6-methyloxan-4-yl]oxyoxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/83912180-8584-11ee-a1e9-7bda8762b5ed.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 95.89% | 97.31% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.53% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.44% | 96.09% |
CHEMBL204 | P00734 | Thrombin | 94.05% | 96.01% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 91.62% | 92.78% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 90.28% | 97.86% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.87% | 92.94% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 89.80% | 95.58% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.39% | 96.77% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.33% | 97.09% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 88.63% | 92.88% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.60% | 100.00% |
CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 88.08% | 98.99% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.05% | 94.45% |
CHEMBL233 | P35372 | Mu opioid receptor | 87.19% | 97.93% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.15% | 95.89% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.04% | 96.61% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.95% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.89% | 95.89% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.01% | 95.93% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 84.95% | 97.28% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 83.86% | 95.38% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.57% | 100.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.45% | 92.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.33% | 86.33% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.87% | 95.50% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.72% | 93.04% |
CHEMBL237 | P41145 | Kappa opioid receptor | 82.53% | 98.10% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 82.11% | 92.86% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.19% | 96.38% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.89% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum asperolanatum |
Solanum chrysotrichum |
PubChem | 11115214 |
LOTUS | LTS0163189 |
wikiData | Q105264364 |