[(3S,4S,5S,10S,13R,14R,17R)-4,10,13-trimethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate
Internal ID | 460afd12-3e58-4b1a-8190-59fc216fd078 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid esters |
IUPAC Name | [(3S,4S,5S,10S,13R,14R,17R)-4,10,13-trimethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
SMILES (Canonical) | CC1C2CCC3=C(C2(CCC1OC(=O)C)C)CCC4(C3CCC4C(C)CCC(=C)C(C)C)C |
SMILES (Isomeric) | C[C@H]1[C@@H]2CCC3=C([C@]2(CC[C@@H]1OC(=O)C)C)CC[C@]4([C@H]3CC[C@@H]4[C@H](C)CCC(=C)C(C)C)C |
InChI | InChI=1S/C31H50O2/c1-19(2)20(3)9-10-21(4)25-13-14-27-24-11-12-26-22(5)29(33-23(6)32)16-18-31(26,8)28(24)15-17-30(25,27)7/h19,21-22,25-27,29H,3,9-18H2,1-2,4-8H3/t21-,22+,25-,26+,27+,29+,30-,31+/m1/s1 |
InChI Key | RNXCGPIFSGPWOB-GTNWKTSESA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H50O2 |
Molecular Weight | 454.70 g/mol |
Exact Mass | 454.381080833 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 9.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.38% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.86% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.86% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.13% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 93.73% | 98.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.51% | 95.89% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.85% | 90.17% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.70% | 91.19% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.29% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.61% | 100.00% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 86.11% | 91.24% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 85.94% | 89.05% |
CHEMBL233 | P35372 | Mu opioid receptor | 84.59% | 97.93% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 83.82% | 97.79% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.80% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.48% | 92.62% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.05% | 91.07% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.80% | 100.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.77% | 94.33% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.04% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phaseolus vulgaris |
PubChem | 14282737 |
LOTUS | LTS0122833 |
wikiData | Q105241885 |