(2R)-4-[2-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethenyl]-2-methoxy-2H-furan-5-one
Internal ID | c46c1781-a7b0-48cf-83ba-e6f9c49882a7 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Diterpene lactones |
IUPAC Name | (2R)-4-[2-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethenyl]-2-methoxy-2H-furan-5-one |
SMILES (Canonical) | CC1(CCCC2(C1CCC(=C)C2C=CC3=CC(OC3=O)OC)C)C |
SMILES (Isomeric) | C[C@]12CCCC([C@@H]1CCC(=C)[C@@H]2C=CC3=C[C@@H](OC3=O)OC)(C)C |
InChI | InChI=1S/C21H30O3/c1-14-7-10-17-20(2,3)11-6-12-21(17,4)16(14)9-8-15-13-18(23-5)24-19(15)22/h8-9,13,16-18H,1,6-7,10-12H2,2-5H3/t16-,17-,18+,21+/m0/s1 |
InChI Key | BQAWJLFWEBGZIH-LXGFNABISA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H30O3 |
Molecular Weight | 330.50 g/mol |
Exact Mass | 330.21949481 g/mol |
Topological Polar Surface Area (TPSA) | 35.50 Ų |
XlogP | 5.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.70% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.90% | 95.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.74% | 97.25% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.12% | 86.33% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 87.96% | 93.40% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.40% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.77% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.65% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.90% | 97.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.78% | 94.75% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 83.68% | 97.05% |
CHEMBL2581 | P07339 | Cathepsin D | 82.66% | 98.95% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.40% | 91.07% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.06% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aframomum sceptrum |
Hedychium coronarium |
PubChem | 162867082 |
LOTUS | LTS0220878 |
wikiData | Q104944248 |