[(3S,4R,5S,6S)-6-[4,5-dihydroxy-2-[5-hydroxy-4-oxo-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-yl]phenoxy]-4,5-dihydroxyoxan-3-yl] acetate
Internal ID | 6d507f77-afa7-4ebb-84e5-83c219184802 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | [(3S,4R,5S,6S)-6-[4,5-dihydroxy-2-[5-hydroxy-4-oxo-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-yl]phenoxy]-4,5-dihydroxyoxan-3-yl] acetate |
SMILES (Canonical) | CC(=O)OC1COC(C(C1O)O)OC2=CC(=C(C=C2C3=CC(=O)C4=C(C=C(C=C4O3)OC5C(C(C(C(O5)CO)O)O)O)O)O)O |
SMILES (Isomeric) | CC(=O)O[C@H]1CO[C@H]([C@H]([C@H]1O)O)OC2=CC(=C(C=C2C3=CC(=O)C4=C(C=C(C=C4O3)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O)O)O |
InChI | InChI=1S/C28H30O17/c1-9(30)41-20-8-40-27(25(38)23(20)36)44-17-5-13(32)12(31)4-11(17)16-6-15(34)21-14(33)2-10(3-18(21)43-16)42-28-26(39)24(37)22(35)19(7-29)45-28/h2-6,19-20,22-29,31-33,35-39H,7-8H2,1H3/t19-,20+,22-,23+,24+,25+,26-,27+,28-/m1/s1 |
InChI Key | GBYRRWUDRLYBIP-CFPYPUSESA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H30O17 |
Molecular Weight | 638.50 g/mol |
Exact Mass | 638.14829948 g/mol |
Topological Polar Surface Area (TPSA) | 272.00 Ų |
XlogP | -1.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.59% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.05% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.42% | 89.00% |
CHEMBL220 | P22303 | Acetylcholinesterase | 94.98% | 94.45% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.81% | 91.49% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 94.61% | 96.21% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.96% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.45% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.30% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.42% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 88.18% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.80% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.48% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.10% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.60% | 90.00% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 84.57% | 97.28% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.88% | 95.89% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.49% | 96.95% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 82.32% | 82.50% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.54% | 99.15% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.40% | 100.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.37% | 94.73% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.35% | 95.78% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.09% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hypochaeris maculata |
PubChem | 163088988 |
LOTUS | LTS0064691 |
wikiData | Q105267151 |