(1S,2R,5R,7S,10R,11R,15S,18S,20R,22R)-7-[(2R,3R,4S,5S,6R)-3-[(2S,3R,4R,5R)-3,4-dihydroxy-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,6,6,10,17,17-hexamethyl-18-[(Z)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxyhexacyclo[12.9.0.01,22.02,11.05,10.015,20]tricos-13-ene-20-carboxylic acid
Internal ID | 6c87c378-ce76-4c6a-b60c-e103aa8cb090 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1S,2R,5R,7S,10R,11R,15S,18S,20R,22R)-7-[(2R,3R,4S,5S,6R)-3-[(2S,3R,4R,5R)-3,4-dihydroxy-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,6,6,10,17,17-hexamethyl-18-[(Z)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxyhexacyclo[12.9.0.01,22.02,11.05,10.015,20]tricos-13-ene-20-carboxylic acid |
SMILES (Canonical) | CC1(CC2C3=CCC4C5(CCC(C(C5CCC4(C36CC6CC2(CC1OC(=O)C=CC7=CC(=C(C(=C7)OC)OC)OC)C(=O)O)C)(C)C)OC8C(C(C(C(O8)CO)O)O)OC9C(C(C(CO9)OC1C(C(C(CO1)O)O)O)O)O)C)C |
SMILES (Isomeric) | C[C@]12CC[C@@H](C([C@@H]1CC[C@@]3([C@@H]2CC=C4[C@]35C[C@@H]5C[C@@]6([C@H]4CC([C@H](C6)OC(=O)/C=C\C7=CC(=C(C(=C7)OC)OC)OC)(C)C)C(=O)O)C)(C)C)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O[C@H]9[C@@H]([C@H]([C@@H](CO9)O[C@H]1[C@@H]([C@H]([C@@H](CO1)O)O)O)O)O |
InChI | InChI=1S/C58H84O21/c1-53(2)22-30-29-11-12-37-55(5)16-15-38(78-51-48(44(65)42(63)34(24-59)75-51)79-50-46(67)43(64)35(26-74-50)76-49-45(66)41(62)31(60)25-73-49)54(3,4)36(55)14-17-56(37,6)58(29)21-28(58)20-57(30,52(68)69)23-39(53)77-40(61)13-10-27-18-32(70-7)47(72-9)33(19-27)71-8/h10-11,13,18-19,28,30-31,34-39,41-46,48-51,59-60,62-67H,12,14-17,20-26H2,1-9H3,(H,68,69)/b13-10-/t28-,30-,31+,34+,35+,36-,37+,38-,39-,41-,42+,43-,44-,45+,46+,48+,49-,50-,51-,55-,56+,57+,58+/m0/s1 |
InChI Key | ZKSYEGZSTCTSIS-SVOUWMIOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C58H84O21 |
Molecular Weight | 1117.30 g/mol |
Exact Mass | 1116.55050968 g/mol |
Topological Polar Surface Area (TPSA) | 309.00 Ų |
XlogP | 3.60 |
There are no found synonyms. |
![2D Structure of (1S,2R,5R,7S,10R,11R,15S,18S,20R,22R)-7-[(2R,3R,4S,5S,6R)-3-[(2S,3R,4R,5R)-3,4-dihydroxy-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,6,6,10,17,17-hexamethyl-18-[(Z)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxyhexacyclo[12.9.0.01,22.02,11.05,10.015,20]tricos-13-ene-20-carboxylic acid 2D Structure of (1S,2R,5R,7S,10R,11R,15S,18S,20R,22R)-7-[(2R,3R,4S,5S,6R)-3-[(2S,3R,4R,5R)-3,4-dihydroxy-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,6,6,10,17,17-hexamethyl-18-[(Z)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxyhexacyclo[12.9.0.01,22.02,11.05,10.015,20]tricos-13-ene-20-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/8288b700-86a6-11ee-a1fe-6d66a790dbe2.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4302 | P08183 | P-glycoprotein 1 | 99.47% | 92.98% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.12% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.03% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.91% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.97% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.14% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.94% | 97.09% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 91.67% | 95.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.09% | 95.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.95% | 96.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.86% | 90.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.40% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.45% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.09% | 97.14% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 86.05% | 97.33% |
CHEMBL5028 | O14672 | ADAM10 | 85.83% | 97.50% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.44% | 91.07% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.37% | 99.17% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.34% | 92.50% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.98% | 95.89% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.74% | 95.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.56% | 92.62% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.04% | 94.75% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.66% | 96.77% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.54% | 95.83% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.23% | 91.19% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.25% | 94.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.82% | 90.00% |
CHEMBL3788 | O00444 | Serine/threonine-protein kinase PLK4 | 81.56% | 83.65% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.36% | 94.33% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.00% | 96.21% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.37% | 96.90% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Verbesina virginica |
PubChem | 162876626 |
LOTUS | LTS0086807 |
wikiData | Q105378706 |