[2,4,5-Tris[(3,4,5-trihydroxybenzoyl)oxy]-6-[(3,4,5-trihydroxybenzoyl)oxymethyl]oxan-3-yl] 5-[[1,2,2,15,16,19,20,21,35,36-decahydroxy-3,6,11,24,32-pentaoxo-29-(3,4,5-trihydroxybenzoyl)oxy-7,10,25,28,31,40-hexaoxaoctacyclo[35.2.1.05,39.08,27.09,30.012,17.018,23.033,38]tetraconta-4,12,14,16,18,20,22,33,35,37-decaen-14-yl]oxy]-2,3,4-trihydroxybenzoate
Internal ID | 5b793eab-0bae-4cd0-bac3-b39ba4a9e200 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [2,4,5-tris[(3,4,5-trihydroxybenzoyl)oxy]-6-[(3,4,5-trihydroxybenzoyl)oxymethyl]oxan-3-yl] 5-[[1,2,2,15,16,19,20,21,35,36-decahydroxy-3,6,11,24,32-pentaoxo-29-(3,4,5-trihydroxybenzoyl)oxy-7,10,25,28,31,40-hexaoxaoctacyclo[35.2.1.05,39.08,27.09,30.012,17.018,23.033,38]tetraconta-4,12,14,16,18,20,22,33,35,37-decaen-14-yl]oxy]-2,3,4-trihydroxybenzoate |
SMILES (Canonical) | C1C2C3C(C(C(O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C6=C5C7C(=CC(=O)C(C7(O6)O)(O)O)C(=O)O3)O)O)OC(=O)C8=CC(=C(C(=C8C9=C(C(=C(C=C9C(=O)O1)O)O)O)O)O)OC1=C(C(=C(C(=C1)C(=O)OC1C(C(C(OC1OC(=O)C1=CC(=C(C(=C1)O)O)O)COC(=O)C1=CC(=C(C(=C1)O)O)O)OC(=O)C1=CC(=C(C(=C1)O)O)O)OC(=O)C1=CC(=C(C(=C1)O)O)O)O)O)O |
SMILES (Isomeric) | C1C2C3C(C(C(O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C6=C5C7C(=CC(=O)C(C7(O6)O)(O)O)C(=O)O3)O)O)OC(=O)C8=CC(=C(C(=C8C9=C(C(=C(C=C9C(=O)O1)O)O)O)O)O)OC1=C(C(=C(C(=C1)C(=O)OC1C(C(C(OC1OC(=O)C1=CC(=C(C(=C1)O)O)O)COC(=O)C1=CC(=C(C(=C1)O)O)O)OC(=O)C1=CC(=C(C(=C1)O)O)O)OC(=O)C1=CC(=C(C(=C1)O)O)O)O)O)O |
InChI | InChI=1S/C82H58O53/c83-28-1-18(2-29(84)50(28)97)69(109)122-16-42-62(127-70(110)19-3-30(85)51(98)31(86)4-19)65(129-71(111)20-5-32(87)52(99)33(88)6-20)67(79(125-42)133-72(112)21-7-34(89)53(100)35(90)8-21)132-78(118)27-14-41(58(105)61(108)49(27)96)124-40-13-25-46(60(107)57(40)104)45-23(11-38(93)55(102)59(45)106)74(114)123-17-43-63-66(130-76(25)116)68(80(126-43)134-73(113)22-9-36(91)54(101)37(92)10-22)131-75(115)24-12-39(94)56(103)64-47(24)48-26(77(117)128-63)15-44(95)81(119,120)82(48,121)135-64/h1-15,42-43,48,62-63,65-68,79-80,83-94,96-108,119-121H,16-17H2 |
InChI Key | LKBLMXZXLQWCKR-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C82H58O53 |
Molecular Weight | 1891.30 g/mol |
Exact Mass | 1890.1843267 g/mol |
Topological Polar Surface Area (TPSA) | 883.00 Ų |
XlogP | 2.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 99.49% | 95.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.46% | 91.11% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 98.63% | 83.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.20% | 86.33% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 94.01% | 96.38% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.48% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 92.35% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.58% | 97.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.64% | 99.15% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 89.67% | 92.50% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.45% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.70% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.63% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.94% | 95.89% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.38% | 91.49% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.90% | 99.23% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.62% | 91.19% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 84.52% | 94.42% |
CHEMBL3194 | P02766 | Transthyretin | 84.49% | 90.71% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 84.02% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.90% | 99.17% |
CHEMBL220 | P22303 | Acetylcholinesterase | 83.82% | 94.45% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 83.62% | 89.63% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.40% | 95.56% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.34% | 92.62% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 82.72% | 93.18% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.70% | 96.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.55% | 90.00% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.09% | 97.21% |
CHEMBL2535 | P11166 | Glucose transporter | 81.17% | 98.75% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.97% | 100.00% |
CHEMBL3891 | P07384 | Calpain 1 | 80.80% | 93.04% |
CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 80.19% | 96.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Euphorbia humifusa |
PubChem | 163035907 |
LOTUS | LTS0208015 |
wikiData | Q105152951 |