[15-[5-Hydroxy-6-methyl-6-(3,4,5-trihydroxyoxan-2-yl)oxyheptan-2-yl]-7,7,12,16-tetramethyl-6,9-bis[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate
| Internal ID | 6750299c-e946-4904-9336-5b0eecc28624 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins > Cucurbitacin glycosides |
| IUPAC Name | [15-[5-hydroxy-6-methyl-6-(3,4,5-trihydroxyoxan-2-yl)oxyheptan-2-yl]-7,7,12,16-tetramethyl-6,9-bis[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2CCC34CC35CCC6(C(C(CC6(C5CC(C4C2(C)C)OC7C(C(C(C(O7)C)O)O)O)C)OC(=O)C)C(C)CCC(C(C)(C)OC8C(C(C(CO8)O)O)O)O)C)O)O)O |
| SMILES (Isomeric) | CC1C(C(C(C(O1)OC2CCC34CC35CCC6(C(C(CC6(C5CC(C4C2(C)C)OC7C(C(C(C(O7)C)O)O)O)C)OC(=O)C)C(C)CCC(C(C)(C)OC8C(C(C(CO8)O)O)O)O)C)O)O)O |
| InChI | InChI=1S/C49H82O18/c1-21(11-12-29(52)45(7,8)67-41-37(58)34(55)25(51)19-61-41)31-27(64-24(4)50)18-47(10)28-17-26(65-42-38(59)35(56)32(53)22(2)62-42)40-44(5,6)30(66-43-39(60)36(57)33(54)23(3)63-43)13-14-49(40)20-48(28,49)16-15-46(31,47)9/h21-23,25-43,51-60H,11-20H2,1-10H3 |
| InChI Key | VQFMHXZXFACJNN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C49H82O18 |
| Molecular Weight | 959.20 g/mol |
| Exact Mass | 958.55011576 g/mol |
| Topological Polar Surface Area (TPSA) | 284.00 Ų |
| XlogP | 1.50 |
| There are no found synonyms. |
![2D Structure of [15-[5-Hydroxy-6-methyl-6-(3,4,5-trihydroxyoxan-2-yl)oxyheptan-2-yl]-7,7,12,16-tetramethyl-6,9-bis[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/82346d20-845a-11ee-acfc-9d84d65387e8.jpg "2D Structure of [15-[5-Hydroxy-6-methyl-6-(3,4,5-trihydroxyoxan-2-yl)oxyheptan-2-yl]-7,7,12,16-tetramethyl-6,9-bis[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy]-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.93% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.37% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.92% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.16% | 98.95% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 93.83% | 95.69% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 93.31% | 95.58% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 93.03% | 95.71% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.64% | 97.09% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 91.80% | 96.77% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 91.64% | 96.47% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 91.48% | 89.50% |
| CHEMBL240 | Q12809 | HERG | 91.45% | 89.76% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 91.24% | 91.24% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 90.83% | 91.07% |
| CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 90.28% | 99.00% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 90.23% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.77% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.35% | 89.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.83% | 85.14% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.57% | 96.95% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.45% | 91.19% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 87.92% | 92.88% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 87.78% | 82.50% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.64% | 100.00% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 87.38% | 85.31% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.81% | 97.14% |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 85.63% | 92.78% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.53% | 94.45% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.98% | 95.89% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 84.91% | 95.17% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.59% | 100.00% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 83.83% | 95.38% |
| CHEMBL203 | P00533 | Epidermal growth factor receptor erbB1 | 83.25% | 97.34% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.96% | 100.00% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 82.70% | 98.05% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.64% | 95.89% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.28% | 95.71% |
| CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 82.25% | 99.17% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.93% | 90.24% |
| CHEMBL4105786 | P41182 | B-cell lymphoma 6 protein | 81.72% | 92.86% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.44% | 92.94% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 80.46% | 98.33% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.12% | 91.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Astragalus cicer |
| Astragalus eremophilus |
| PubChem | 74343975 |
| LOTUS | LTS0187287 |
| wikiData | Q105291221 |