8,2'-Dihydroxyflavone
| Internal ID | 72bca0b2-34ad-4d15-88a4-870a85f362ac |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones |
| IUPAC Name | 8-hydroxy-2-(2-hydroxyphenyl)chromen-4-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H10O4/c16-11-6-2-1-4-9(11)14-8-13(18)10-5-3-7-12(17)15(10)19-14/h1-8,16-17H |
| InChI Key | JDYIVENBODOXQO-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C15H10O4 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.05790880 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 2.50 |
| 115713-41-2 |
| RefChem:106744 |
| 8-hydroxy-2-(2-hydroxyphenyl)chromen-4-one |
| DTXSID501036996 |
| LMPK12110083 |
| 8-Hydroxy-2-(2-hydroxyphenyl)-4H-chromen-4-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.64% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.42% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.41% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.33% | 91.49% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.30% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.45% | 99.23% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.58% | 99.15% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.52% | 94.73% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.63% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.72% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.21% | 94.00% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 82.65% | 83.57% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 81.73% | 96.00% |
| CHEMBL3194 | P02766 | Transthyretin | 81.25% | 90.71% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.33% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Primula pulverulenta |
| PubChem | 14034267 |
| LOTUS | LTS0175268 |
| wikiData | Q105125859 |