[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate
Internal ID | 887a0876-e7c8-42b5-a311-c19808d1635d |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
IUPAC Name | [(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1=CCC2C(CCCC2(C1OC(=O)C=CC3=CC(=C(C=C3)O)O)C)(C)C |
SMILES (Isomeric) | CC1=CC[C@@H]2[C@@]([C@H]1OC(=O)/C=C/C3=CC(=C(C=C3)O)O)(CCCC2(C)C)C |
InChI | InChI=1S/C23H30O4/c1-15-6-10-19-22(2,3)12-5-13-23(19,4)21(15)27-20(26)11-8-16-7-9-17(24)18(25)14-16/h6-9,11,14,19,21,24-25H,5,10,12-13H2,1-4H3/b11-8+/t19-,21-,23-/m0/s1 |
InChI Key | PCUAJYJVONNANK-OBMMMBRKSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C23H30O4 |
Molecular Weight | 370.50 g/mol |
Exact Mass | 370.21440943 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 5.40 |
There are no found synonyms. |
![2D Structure of [(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate 2D Structure of [(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/81fffbe0-853a-11ee-90e2-31539bb7c940.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.53% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.34% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.97% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.01% | 91.49% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.30% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.42% | 89.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.70% | 94.75% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.63% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.51% | 99.15% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.08% | 93.99% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.27% | 94.73% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.47% | 95.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.33% | 97.09% |
CHEMBL3194 | P02766 | Transthyretin | 82.69% | 90.71% |
CHEMBL2581 | P07339 | Cathepsin D | 82.23% | 98.95% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.23% | 91.07% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.04% | 90.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.29% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bazzania fauriana |
PubChem | 163191121 |
LOTUS | LTS0083569 |
wikiData | Q105206044 |