8-[(7-Hydroxy-5-methoxy-9,10-dihydrophenanthren-2-yl)oxy]-6-methoxy-9,10-dihydrophenanthrene-2,5-diol
| Internal ID | ac6bd966-fc6b-4022-a3e6-721a2a5a8a4c |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Hydrophenanthrenes |
| IUPAC Name | 8-[(7-hydroxy-5-methoxy-9,10-dihydrophenanthren-2-yl)oxy]-6-methoxy-9,10-dihydrophenanthrene-2,5-diol |
| SMILES (Canonical) | COC1=CC(=CC2=C1C3=C(CC2)C=C(C=C3)OC4=CC(=C(C5=C4CCC6=C5C=CC(=C6)O)O)OC)O |
| SMILES (Isomeric) | COC1=CC(=CC2=C1C3=C(CC2)C=C(C=C3)OC4=CC(=C(C5=C4CCC6=C5C=CC(=C6)O)O)OC)O |
| InChI | InChI=1S/C30H26O6/c1-34-26-14-20(32)12-18-4-3-17-13-21(7-10-22(17)28(18)26)36-25-15-27(35-2)30(33)29-23-9-6-19(31)11-16(23)5-8-24(25)29/h6-7,9-15,31-33H,3-5,8H2,1-2H3 |
| InChI Key | BJEOFEXAWYPDKM-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H26O6 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.17293854 g/mol |
| Topological Polar Surface Area (TPSA) | 88.40 Ų |
| XlogP | 6.20 |
| There are no found synonyms. |
![2D Structure of 8-[(7-Hydroxy-5-methoxy-9,10-dihydrophenanthren-2-yl)oxy]-6-methoxy-9,10-dihydrophenanthrene-2,5-diol](https://plantaedb.com/storage/docs/compounds/2023/11/81eda1a0-8829-11ee-868c-1b7d4f67c7a6.jpg "2D Structure of 8-[(7-Hydroxy-5-methoxy-9,10-dihydrophenanthren-2-yl)oxy]-6-methoxy-9,10-dihydrophenanthrene-2,5-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.64% | 91.11% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 97.86% | 98.35% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.81% | 91.49% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 96.24% | 91.79% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.27% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.97% | 96.09% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 93.52% | 91.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.48% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.14% | 90.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.33% | 95.89% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.58% | 95.89% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.42% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.13% | 98.75% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.03% | 99.15% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 88.08% | 93.31% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.01% | 99.17% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.92% | 94.00% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 87.89% | 83.14% |
| CHEMBL5145 | P15056 | Serine/threonine-protein kinase B-raf | 86.37% | 97.90% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 85.45% | 96.09% |
| CHEMBL3194 | P02766 | Transthyretin | 84.69% | 90.71% |
| CHEMBL1293289 | P25440 | Bromodomain-containing protein 2 | 84.44% | 86.19% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 83.25% | 82.67% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 83.19% | 92.68% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 81.64% | 95.78% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 81.28% | 100.00% |
| CHEMBL3085 | P43003 | Excitatory amino acid transporter 1 | 80.83% | 94.67% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.27% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pholidota chinensis |
| PubChem | 102026935 |
| LOTUS | LTS0269377 |
| wikiData | Q104937014 |