(1S,3R,4R,5R)-3-[(E)-3-[4-[(2S,3R,4S,5S,6R)-6-[[(1S,3R,4R,5R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,4,5-trihydroxycyclohexanecarbonyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-3-hydroxyphenyl]prop-2-enoyl]oxy-1,4,5-trihydroxycyclohexane-1-carboxylic acid
Internal ID | db42cd77-6fe0-444f-a865-147c0644ce3b |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | (1S,3R,4R,5R)-3-[(E)-3-[4-[(2S,3R,4S,5S,6R)-6-[[(1S,3R,4R,5R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,4,5-trihydroxycyclohexanecarbonyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-3-hydroxyphenyl]prop-2-enoyl]oxy-1,4,5-trihydroxycyclohexane-1-carboxylic acid |
SMILES (Canonical) | C1C(C(C(CC1(C(=O)O)O)OC(=O)C=CC2=CC(=C(C=C2)OC3C(C(C(C(O3)COC(=O)C4(CC(C(C(C4)OC(=O)C=CC5=CC(=C(C=C5)O)O)O)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@H]([C@H]([C@@H](C[C@@]1(C(=O)O)O)OC(=O)/C=C/C2=CC(=C(C=C2)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)COC(=O)[C@@]4(C[C@H]([C@H]([C@@H](C4)OC(=O)/C=C/C5=CC(=C(C=C5)O)O)O)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C38H44O22/c39-18-5-1-16(9-19(18)40)3-7-28(45)58-25-14-38(55,12-22(43)30(25)47)36(53)56-15-26-31(48)32(49)33(50)34(60-26)59-23-6-2-17(10-20(23)41)4-8-27(44)57-24-13-37(54,35(51)52)11-21(42)29(24)46/h1-10,21-22,24-26,29-34,39-43,46-50,54-55H,11-15H2,(H,51,52)/b7-3+,8-4+/t21-,22-,24-,25-,26-,29-,30-,31-,32+,33-,34-,37+,38+/m1/s1 |
InChI Key | MEGCMHCHWAMJBV-QCNSHTHNSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C38H44O22 |
Molecular Weight | 852.70 g/mol |
Exact Mass | 852.23242303 g/mol |
Topological Polar Surface Area (TPSA) | 377.00 Ų |
XlogP | -2.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.66% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.60% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.68% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.47% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.21% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 92.92% | 90.71% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 92.60% | 91.49% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.23% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.07% | 97.09% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 90.83% | 85.31% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.95% | 83.82% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.12% | 95.56% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.04% | 95.50% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 88.03% | 83.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.74% | 90.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.49% | 95.89% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 84.95% | 97.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.78% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.17% | 94.73% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.54% | 86.92% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.41% | 89.62% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.21% | 80.78% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.01% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum viarum |
PubChem | 71456110 |
LOTUS | LTS0142037 |
wikiData | Q105162214 |