[(2S,3R,4S,5R,6R)-2-[[(1S,5S,6R,8R,10R,12S)-6-[2-(1-carbamimidoyl-2,5-dihydropyrrol-3-yl)ethylcarbamoyl]-12-hydroxy-7-[(2R)-2-[[(2S)-2-methoxy-3-sulfooxypropanoyl]amino]-4-methylpentanoyl]-3-oxo-2-oxa-4,7-diazatricyclo[6.3.1.01,5]dodecan-10-yl]oxy]-4-carbamoyloxy-5-hydroxy-6-(hydroxymethyl)oxan-3-yl] hexanoate
Internal ID | c1759560-00e1-463a-9c76-d51a2d6f8499 |
Taxonomy | Lipids and lipid-like molecules > Saccharolipids |
IUPAC Name | [(2S,3R,4S,5R,6R)-2-[[(1S,5S,6R,8R,10R,12S)-6-[2-(1-carbamimidoyl-2,5-dihydropyrrol-3-yl)ethylcarbamoyl]-12-hydroxy-7-[(2R)-2-[[(2S)-2-methoxy-3-sulfooxypropanoyl]amino]-4-methylpentanoyl]-3-oxo-2-oxa-4,7-diazatricyclo[6.3.1.01,5]dodecan-10-yl]oxy]-4-carbamoyloxy-5-hydroxy-6-(hydroxymethyl)oxan-3-yl] hexanoate |
SMILES (Canonical) | CCCCCC(=O)OC1C(C(C(OC1OC2CC3C(C4(C2)C(C(N3C(=O)C(CC(C)C)NC(=O)C(COS(=O)(=O)O)OC)C(=O)NCCC5=CCN(C5)C(=N)N)NC(=O)O4)O)CO)O)OC(=O)N |
SMILES (Isomeric) | CCCCCC(=O)O[C@@H]1[C@H]([C@@H]([C@H](O[C@@H]1O[C@@H]2C[C@@H]3[C@@H]([C@]4(C2)[C@H]([C@@H](N3C(=O)[C@@H](CC(C)C)NC(=O)[C@H](COS(=O)(=O)O)OC)C(=O)NCCC5=CCN(C5)C(=N)N)NC(=O)O4)O)CO)O)OC(=O)N |
InChI | InChI=1S/C40H64N8O19S/c1-5-6-7-8-26(50)65-30-29(66-38(43)56)28(51)24(17-49)64-36(30)63-21-14-23-32(52)40(15-21)31(46-39(57)67-40)27(34(54)44-11-9-20-10-12-47(16-20)37(41)42)48(23)35(55)22(13-19(2)3)45-33(53)25(61-4)18-62-68(58,59)60/h10,19,21-25,27-32,36,49,51-52H,5-9,11-18H2,1-4H3,(H3,41,42)(H2,43,56)(H,44,54)(H,45,53)(H,46,57)(H,58,59,60)/t21-,22-,23-,24-,25+,27-,28-,29+,30-,31+,32+,36+,40+/m1/s1 |
InChI Key | UQTGAESHECRZID-ICNKCJGYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C40H64N8O19S |
Molecular Weight | 993.00 g/mol |
Exact Mass | 992.40084301 g/mol |
Topological Polar Surface Area (TPSA) | 409.00 Ų |
XlogP | -2.50 |
Atomic LogP (AlogP) | -3.01 |
H-Bond Acceptor | 19 |
H-Bond Donor | 10 |
Rotatable Bonds | 22 |
There are no found synonyms. |
![2D Structure of [(2S,3R,4S,5R,6R)-2-[[(1S,5S,6R,8R,10R,12S)-6-[2-(1-carbamimidoyl-2,5-dihydropyrrol-3-yl)ethylcarbamoyl]-12-hydroxy-7-[(2R)-2-[[(2S)-2-methoxy-3-sulfooxypropanoyl]amino]-4-methylpentanoyl]-3-oxo-2-oxa-4,7-diazatricyclo[6.3.1.01,5]dodecan-10-yl]oxy]-4-carbamoyloxy-5-hydroxy-6-(hydroxymethyl)oxan-3-yl] hexanoate 2D Structure of [(2S,3R,4S,5R,6R)-2-[[(1S,5S,6R,8R,10R,12S)-6-[2-(1-carbamimidoyl-2,5-dihydropyrrol-3-yl)ethylcarbamoyl]-12-hydroxy-7-[(2R)-2-[[(2S)-2-methoxy-3-sulfooxypropanoyl]amino]-4-methylpentanoyl]-3-oxo-2-oxa-4,7-diazatricyclo[6.3.1.01,5]dodecan-10-yl]oxy]-4-carbamoyloxy-5-hydroxy-6-(hydroxymethyl)oxan-3-yl] hexanoate](https://plantaedb.com/storage/docs/compounds/2023/07/81926010-265f-11ee-ac75-cf59170f612a.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.8689 | 86.89% |
Caco-2 | - | 0.8626 | 86.26% |
Blood Brain Barrier | - | 0.6000 | 60.00% |
Human oral bioavailability | - | 0.7857 | 78.57% |
Subcellular localzation | Lysosomes | 0.4284 | 42.84% |
OATP2B1 inhibitior | - | 0.8608 | 86.08% |
OATP1B1 inhibitior | + | 0.8144 | 81.44% |
OATP1B3 inhibitior | + | 0.9252 | 92.52% |
MATE1 inhibitior | - | 0.8054 | 80.54% |
OCT2 inhibitior | - | 0.8250 | 82.50% |
BSEP inhibitior | + | 0.7435 | 74.35% |
P-glycoprotein inhibitior | + | 0.7476 | 74.76% |
P-glycoprotein substrate | + | 0.8682 | 86.82% |
CYP3A4 substrate | + | 0.7479 | 74.79% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8580 | 85.80% |
CYP3A4 inhibition | - | 0.9018 | 90.18% |
CYP2C9 inhibition | - | 0.7173 | 71.73% |
CYP2C19 inhibition | - | 0.6701 | 67.01% |
CYP2D6 inhibition | - | 0.8668 | 86.68% |
CYP1A2 inhibition | - | 0.6914 | 69.14% |
CYP2C8 inhibition | + | 0.8054 | 80.54% |
CYP inhibitory promiscuity | - | 0.9452 | 94.52% |
UGT catelyzed | + | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 0.6000 | 60.00% |
Carcinogenicity (trinary) | Non-required | 0.5186 | 51.86% |
Eye corrosion | - | 0.9758 | 97.58% |
Eye irritation | - | 0.9019 | 90.19% |
Skin irritation | - | 0.7519 | 75.19% |
Skin corrosion | - | 0.9078 | 90.78% |
Ames mutagenesis | - | 0.5854 | 58.54% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.5054 | 50.54% |
Micronuclear | + | 0.7900 | 79.00% |
Hepatotoxicity | + | 0.5252 | 52.52% |
skin sensitisation | - | 0.8205 | 82.05% |
Respiratory toxicity | + | 0.7889 | 78.89% |
Reproductive toxicity | + | 0.9111 | 91.11% |
Mitochondrial toxicity | + | 0.6000 | 60.00% |
Nephrotoxicity | - | 0.6274 | 62.74% |
Acute Oral Toxicity (c) | III | 0.5721 | 57.21% |
Estrogen receptor binding | + | 0.8111 | 81.11% |
Androgen receptor binding | + | 0.7377 | 73.77% |
Thyroid receptor binding | + | 0.5738 | 57.38% |
Glucocorticoid receptor binding | + | 0.6742 | 67.42% |
Aromatase binding | + | 0.6608 | 66.08% |
PPAR gamma | + | 0.7919 | 79.19% |
Honey bee toxicity | - | 0.6396 | 63.96% |
Biodegradation | - | 0.7250 | 72.50% |
Crustacea aquatic toxicity | - | 0.5352 | 53.52% |
Fish aquatic toxicity | + | 0.9468 | 94.68% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.78% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 99.74% | 98.95% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 99.23% | 96.21% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.20% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.19% | 91.11% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 98.97% | 94.66% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 98.20% | 97.09% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 97.64% | 91.81% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 96.88% | 100.00% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 96.85% | 89.63% |
CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 96.62% | 90.24% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 96.60% | 93.56% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 96.21% | 97.79% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 95.79% | 95.71% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 95.56% | 92.86% |
CHEMBL299 | P17252 | Protein kinase C alpha | 95.47% | 98.03% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 94.23% | 98.59% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.02% | 97.25% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.90% | 96.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 93.21% | 97.14% |
CHEMBL1801 | P00747 | Plasminogen | 93.08% | 92.44% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 93.01% | 98.05% |
CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 92.77% | 92.29% |
CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 92.76% | 95.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 92.64% | 92.50% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 91.66% | 92.88% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 91.07% | 94.33% |
CHEMBL5028 | O14672 | ADAM10 | 91.03% | 97.50% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 91.00% | 96.90% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.00% | 95.56% |
CHEMBL204 | P00734 | Thrombin | 90.37% | 96.01% |
CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 90.19% | 96.31% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.78% | 97.29% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 89.72% | 100.00% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 89.69% | 95.83% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.66% | 91.19% |
CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 89.15% | 96.28% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 89.09% | 91.03% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.73% | 99.17% |
CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 88.61% | 92.38% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 88.59% | 94.00% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 88.45% | 96.25% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.39% | 99.23% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.96% | 95.50% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.35% | 90.71% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 87.16% | 100.00% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 87.14% | 98.33% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 86.60% | 90.08% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.58% | 89.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.38% | 96.47% |
CHEMBL5646 | Q6L5J4 | FML2_HUMAN | 86.11% | 100.00% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 85.80% | 97.64% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.74% | 90.17% |
CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 85.66% | 92.12% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.35% | 95.89% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.55% | 97.21% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 82.67% | 92.32% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 80.89% | 92.08% |
CHEMBL3776 | Q14790 | Caspase-8 | 80.82% | 97.06% |
CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 80.40% | 97.50% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.17% | 93.18% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.10% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Neurolaena lobata |
PubChem | 102411750 |
NPASS | NPC218754 |
LOTUS | LTS0038978 |
wikiData | Q105277445 |