8,15-Dihydroxy-7,14-diphenyl-1,6,10-triazabicyclo[11.3.0]hexadecane-9,16-dione
| Internal ID | cb4e28a1-aaf6-46b2-87a3-87c829e9f1ba |
| Taxonomy | Phenylpropanoids and polyketides > Macrolactams |
| IUPAC Name | 8,15-dihydroxy-7,14-diphenyl-1,6,10-triazabicyclo[11.3.0]hexadecane-9,16-dione |
| SMILES (Canonical) | C1CCN2C(CCNC(=O)C(C(NC1)C3=CC=CC=C3)O)C(C(C2=O)O)C4=CC=CC=C4 |
| SMILES (Isomeric) | C1CCN2C(CCNC(=O)C(C(NC1)C3=CC=CC=C3)O)C(C(C2=O)O)C4=CC=CC=C4 |
| InChI | InChI=1S/C25H31N3O4/c29-22-20(17-9-3-1-4-10-17)19-13-15-27-24(31)23(30)21(18-11-5-2-6-12-18)26-14-7-8-16-28(19)25(22)32/h1-6,9-12,19-23,26,29-30H,7-8,13-16H2,(H,27,31) |
| InChI Key | DJVJIXPENPIGEU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.23145648 g/mol |
| Topological Polar Surface Area (TPSA) | 102.00 Ų |
| XlogP | 1.30 |
| There are no found synonyms. |
![2D Structure of 8,15-Dihydroxy-7,14-diphenyl-1,6,10-triazabicyclo[11.3.0]hexadecane-9,16-dione](https://plantaedb.com/storage/docs/compounds/2023/11/815-dihydroxy-714-diphenyl-1610-triazabicyclo1130hexadecane-916-dione.jpg "2D Structure of 8,15-Dihydroxy-7,14-diphenyl-1,6,10-triazabicyclo[11.3.0]hexadecane-9,16-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.62% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.39% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.00% | 96.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.47% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.46% | 95.56% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.36% | 93.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 86.42% | 93.03% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 84.70% | 97.05% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.52% | 99.23% |
| CHEMBL228 | P31645 | Serotonin transporter | 84.16% | 95.51% |
| CHEMBL238 | Q01959 | Dopamine transporter | 83.82% | 95.88% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.46% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pleurostylia opposita |
| PubChem | 162973405 |
| LOTUS | LTS0213893 |
| wikiData | Q104982835 |