8,12,12-Trimethyl-6-oxatetracyclo[6.4.0.01,3.05,7]dodecan-4-one
Internal ID | f7afd7f6-c39a-4b2a-81b1-d22984a51d21 |
Taxonomy | Organoheterocyclic compounds > Oxepanes |
IUPAC Name | 8,12,12-trimethyl-6-oxatetracyclo[6.4.0.01,3.05,7]dodecan-4-one |
SMILES (Canonical) | CC1(CCCC2(C13CC3C(=O)C4C2O4)C)C |
SMILES (Isomeric) | CC1(CCCC2(C13CC3C(=O)C4C2O4)C)C |
InChI | InChI=1S/C14H20O2/c1-12(2)5-4-6-13(3)11-10(16-11)9(15)8-7-14(8,12)13/h8,10-11H,4-7H2,1-3H3 |
InChI Key | VIYHCJCTDHYTAS-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C14H20O2 |
Molecular Weight | 220.31 g/mol |
Exact Mass | 220.146329876 g/mol |
Topological Polar Surface Area (TPSA) | 29.60 Ų |
XlogP | 2.80 |
There are no found synonyms. |
![2D Structure of 8,12,12-Trimethyl-6-oxatetracyclo[6.4.0.01,3.05,7]dodecan-4-one 2D Structure of 8,12,12-Trimethyl-6-oxatetracyclo[6.4.0.01,3.05,7]dodecan-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/81212-trimethyl-6-oxatetracyclo640013057dodecan-4-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 91.59% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.31% | 91.11% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 90.08% | 82.69% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.04% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.87% | 91.49% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.56% | 97.25% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.10% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.02% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.48% | 86.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.09% | 100.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.31% | 96.77% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.08% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.01% | 97.09% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 81.40% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cupressus bakeri |
PubChem | 14239445 |
LOTUS | LTS0069708 |
wikiData | Q105287094 |