27-Methoxy-7,22-dimethyl-15,29,31-trioxa-7,22-diazaoctacyclo[19.9.3.216,19.14,30.110,14.03,8.025,33.028,32]heptatriaconta-1(30),2,4(34),10(37),11,13,16,18,25,27,32,35-dodecaen-13-ol
Internal ID | eda1240e-32ed-4730-b6f0-43ff064ed996 |
Taxonomy | Lignans, neolignans and related compounds |
IUPAC Name | 27-methoxy-7,22-dimethyl-15,29,31-trioxa-7,22-diazaoctacyclo[19.9.3.216,19.14,30.110,14.03,8.025,33.028,32]heptatriaconta-1(30),2,4(34),10(37),11,13,16,18,25,27,32,35-dodecaen-13-ol |
SMILES (Canonical) | CN1CCC2=CC(=C3C4=C2C1CC5=CC=C(C=C5)OC6=C(C=CC(=C6)CC7C8=CC(=C(O3)C=C8CCN7C)O4)O)OC |
SMILES (Isomeric) | CN1CCC2=CC(=C3C4=C2C1CC5=CC=C(C=C5)OC6=C(C=CC(=C6)CC7C8=CC(=C(O3)C=C8CCN7C)O4)O)OC |
InChI | InChI=1S/C35H34N2O5/c1-36-12-10-22-17-30-31-19-25(22)26(36)15-21-6-9-28(38)29(16-21)40-24-7-4-20(5-8-24)14-27-33-23(11-13-37(27)2)18-32(39-3)34(41-30)35(33)42-31/h4-9,16-19,26-27,38H,10-15H2,1-3H3 |
InChI Key | GOYCVNCWKXBQBF-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H34N2O5 |
Molecular Weight | 562.70 g/mol |
Exact Mass | 562.24677219 g/mol |
Topological Polar Surface Area (TPSA) | 63.60 Ų |
XlogP | 6.00 |
There are no found synonyms. |
![2D Structure of 27-Methoxy-7,22-dimethyl-15,29,31-trioxa-7,22-diazaoctacyclo[19.9.3.216,19.14,30.110,14.03,8.025,33.028,32]heptatriaconta-1(30),2,4(34),10(37),11,13,16,18,25,27,32,35-dodecaen-13-ol 2D Structure of 27-Methoxy-7,22-dimethyl-15,29,31-trioxa-7,22-diazaoctacyclo[19.9.3.216,19.14,30.110,14.03,8.025,33.028,32]heptatriaconta-1(30),2,4(34),10(37),11,13,16,18,25,27,32,35-dodecaen-13-ol](https://plantaedb.com/storage/docs/compounds/2023/11/8112e0b0-86ec-11ee-a9cb-832935fd65a9.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.50% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.30% | 91.11% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 95.24% | 95.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.11% | 95.56% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 92.05% | 91.00% |
CHEMBL2581 | P07339 | Cathepsin D | 91.84% | 98.95% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.29% | 93.99% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.19% | 90.71% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.58% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.83% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.39% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.93% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.75% | 89.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 84.82% | 93.40% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.64% | 89.62% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 83.95% | 82.38% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.75% | 90.00% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 83.55% | 90.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.33% | 94.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.96% | 92.94% |
CHEMBL2535 | P11166 | Glucose transporter | 82.70% | 98.75% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.36% | 100.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 82.28% | 91.49% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.06% | 89.50% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.73% | 80.78% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.48% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Albertisia delagoensis |
Cocculus pendulus |
Pachygone dasycarpa |
Triclisia gilletii |
Triclisia sacleuxii |
PubChem | 10099394 |
LOTUS | LTS0172047 |
wikiData | Q105014716 |