N-benzyl-9-[3,4-dimethoxy-5-[[3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxymethyl]oxolan-2-yl]-N-methylpurin-6-amine
Internal ID | 3e2eae95-7aa4-4e31-ad7d-563ebaab23ba |
Taxonomy | Nucleosides, nucleotides, and analogues > Purine nucleosides |
IUPAC Name | N-benzyl-9-[3,4-dimethoxy-5-[[3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxymethyl]oxolan-2-yl]-N-methylpurin-6-amine |
SMILES (Canonical) | CN(CC1=CC=CC=C1)C2=NC=NC3=C2N=CN3C4C(C(C(O4)COC5C(C(C(C(O5)COC)OC)OC)OC)OC)OC |
SMILES (Isomeric) | CN(CC1=CC=CC=C1)C2=NC=NC3=C2N=CN3C4C(C(C(O4)COC5C(C(C(C(O5)COC)OC)OC)OC)OC)OC |
InChI | InChI=1S/C30H43N5O9/c1-34(13-18-11-9-8-10-12-18)27-21-28(32-16-31-27)35(17-33-21)29-25(40-6)23(38-4)20(43-29)15-42-30-26(41-7)24(39-5)22(37-3)19(44-30)14-36-2/h8-12,16-17,19-20,22-26,29-30H,13-15H2,1-7H3 |
InChI Key | MQRNLZPXGHSBCH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H43N5O9 |
Molecular Weight | 617.70 g/mol |
Exact Mass | 617.30607797 g/mol |
Topological Polar Surface Area (TPSA) | 130.00 Ų |
XlogP | 0.90 |
There are no found synonyms. |
![2D Structure of N-benzyl-9-[3,4-dimethoxy-5-[[3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxymethyl]oxolan-2-yl]-N-methylpurin-6-amine 2D Structure of N-benzyl-9-[3,4-dimethoxy-5-[[3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxymethyl]oxolan-2-yl]-N-methylpurin-6-amine](https://plantaedb.com/storage/docs/compounds/2023/11/80e59c90-8546-11ee-a146-b78e2e560434.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.02% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.66% | 98.95% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 93.64% | 94.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.66% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.38% | 94.73% |
CHEMBL3891 | P07384 | Calpain 1 | 90.15% | 93.04% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.28% | 94.00% |
CHEMBL4523377 | Q86WV6 | Stimulator of interferon genes protein | 87.80% | 95.48% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 87.61% | 95.64% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.84% | 99.17% |
CHEMBL5524 | Q99873 | Protein-arginine N-methyltransferase 1 | 85.44% | 96.67% |
CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 83.70% | 93.81% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 83.67% | 93.65% |
CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 82.32% | 88.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.86% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gerbera jamesonii |
PubChem | 14779581 |
LOTUS | LTS0270904 |
wikiData | Q105170233 |