7-(3-Aminopropyl)-10,11-dioxo-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,8-triene-6-carboxylic acid
| Internal ID | 069a723e-3795-4a46-a1e9-ff18dd387406 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Quinoline carboxylic acids |
| IUPAC Name | 7-(3-aminopropyl)-10,11-dioxo-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,8-triene-6-carboxylic acid |
| SMILES (Canonical) | C1C(N(C2=CC(=O)C(=O)C3=C2C1=CN3)CCCN)C(=O)O |
| SMILES (Isomeric) | C1C(N(C2=CC(=O)C(=O)C3=C2C1=CN3)CCCN)C(=O)O |
| InChI | InChI=1S/C14H15N3O4/c15-2-1-3-17-8-5-10(18)13(19)12-11(8)7(6-16-12)4-9(17)14(20)21/h5-6,9,16H,1-4,15H2,(H,20,21) |
| InChI Key | GIHACZHGZUTZSY-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10625597 g/mol |
| Topological Polar Surface Area (TPSA) | 117.00 Ų |
| XlogP | -2.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.48% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.47% | 98.95% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 94.51% | 95.62% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.08% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.24% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.81% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.57% | 94.45% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 87.52% | 98.59% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 87.38% | 80.71% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 84.01% | 93.18% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.83% | 93.03% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.23% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162927679 |
| LOTUS | LTS0130612 |
| wikiData | Q103816621 |