7-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-6-methoxychromen-4-one
Internal ID | 1b7032f3-2466-4eab-aa45-7a7df0b1f00b |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 7-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-6-methoxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3=C(C(=C4C(=C3)OC(=CC4=O)C5=CC=C(C=C5)O)O)OC)CO)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2OC3=C(C(=C4C(=C3)OC(=CC4=O)C5=CC=C(C=C5)O)O)OC)CO)O)O)O)O)O |
InChI | InChI=1S/C28H32O15/c1-10-19(32)22(35)24(37)27(39-10)43-26-23(36)20(33)17(9-29)42-28(26)41-16-8-15-18(21(34)25(16)38-2)13(31)7-14(40-15)11-3-5-12(30)6-4-11/h3-8,10,17,19-20,22-24,26-30,32-37H,9H2,1-2H3/t10-,17+,19-,20+,22+,23-,24+,26+,27-,28+/m0/s1 |
InChI Key | HVGMINHJTDNOLV-ZTJBHOJDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H32O15 |
Molecular Weight | 608.50 g/mol |
Exact Mass | 608.17412031 g/mol |
Topological Polar Surface Area (TPSA) | 234.00 Ų |
XlogP | -0.30 |
There are no found synonyms. |
![2D Structure of 7-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-6-methoxychromen-4-one 2D Structure of 7-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-6-methoxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/80ccf050-87c3-11ee-8aca-89d62370c4ca.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.61% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.54% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.41% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.77% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.85% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.81% | 86.33% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 91.11% | 96.21% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.18% | 99.17% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.62% | 95.89% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 87.87% | 91.49% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 87.73% | 83.57% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 87.46% | 86.92% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.61% | 94.73% |
CHEMBL3194 | P02766 | Transthyretin | 85.41% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.62% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.61% | 96.09% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 84.03% | 95.64% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 83.67% | 95.78% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.98% | 90.71% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.50% | 99.15% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.70% | 93.10% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.46% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cirsium japonicum |
PubChem | 101926086 |
LOTUS | LTS0129427 |
wikiData | Q105034241 |