2-[[(7R,8S,10R,28S,29R)-1,16,17,18,22,23,34,35,39,39-decahydroxy-2,5,13,26,31-pentaoxo-8-(3,4,5-trihydroxybenzoyl)oxy-6,9,12,27,30,40-hexaoxaoctacyclo[34.3.1.04,38.07,28.010,29.014,19.020,25.032,37]tetraconta-3,14,16,18,20,22,24,32,34,36-decaen-21-yl]oxy]-3,4,5-trihydroxybenzoic acid
Internal ID | 369c8179-d4fd-4a46-bd2f-8e737f368bd4 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | 2-[[(7R,8S,10R,28S,29R)-1,16,17,18,22,23,34,35,39,39-decahydroxy-2,5,13,26,31-pentaoxo-8-(3,4,5-trihydroxybenzoyl)oxy-6,9,12,27,30,40-hexaoxaoctacyclo[34.3.1.04,38.07,28.010,29.014,19.020,25.032,37]tetraconta-3,14,16,18,20,22,24,32,34,36-decaen-21-yl]oxy]-3,4,5-trihydroxybenzoic acid |
SMILES (Canonical) | C1C2C3C(C(C(O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=O)C6(C(C5C7=C(O6)C(=C(C=C7C(=O)O3)O)O)(O)O)O)OC(=O)C8=CC(=C(C(=C8C9=C(C(=C(C=C9C(=O)O1)O)O)O)OC1=C(C(=C(C=C1C(=O)O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@@H]2[C@@H]3[C@@H]([C@H]([C@@H](O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=O)C6(C(C5C7=C(O6)C(=C(C=C7C(=O)O3)O)O)(O)O)O)OC(=O)C8=CC(=C(C(=C8C9=C(C(=C(C=C9C(=O)O1)O)O)O)OC1=C(C(=C(C=C1C(=O)O)O)O)O)O)O |
InChI | InChI=1S/C48H32O32/c49-15-1-9(2-16(50)27(15)56)41(65)79-46-39-38-35(76-44(68)12-5-20(54)31(60)37-25(12)26-13(45(69)78-39)7-22(55)48(72,80-37)47(26,70)71)21(74-46)8-73-42(66)10-3-17(51)28(57)32(61)23(10)24-11(43(67)77-38)4-19(53)30(59)36(24)75-34-14(40(63)64)6-18(52)29(58)33(34)62/h1-7,21,26,35,38-39,46,49-54,56-62,70-72H,8H2,(H,63,64)/t21-,26?,35-,38+,39-,46+,48?/m1/s1 |
InChI Key | IQHBVWNRXJBPSD-VSUFQILUSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H32O32 |
Molecular Weight | 1120.70 g/mol |
Exact Mass | 1120.0876688 g/mol |
Topological Polar Surface Area (TPSA) | 537.00 Ų |
XlogP | -0.20 |
There are no found synonyms. |
![2D Structure of 2-[[(7R,8S,10R,28S,29R)-1,16,17,18,22,23,34,35,39,39-decahydroxy-2,5,13,26,31-pentaoxo-8-(3,4,5-trihydroxybenzoyl)oxy-6,9,12,27,30,40-hexaoxaoctacyclo[34.3.1.04,38.07,28.010,29.014,19.020,25.032,37]tetraconta-3,14,16,18,20,22,24,32,34,36-decaen-21-yl]oxy]-3,4,5-trihydroxybenzoic acid 2D Structure of 2-[[(7R,8S,10R,28S,29R)-1,16,17,18,22,23,34,35,39,39-decahydroxy-2,5,13,26,31-pentaoxo-8-(3,4,5-trihydroxybenzoyl)oxy-6,9,12,27,30,40-hexaoxaoctacyclo[34.3.1.04,38.07,28.010,29.014,19.020,25.032,37]tetraconta-3,14,16,18,20,22,24,32,34,36-decaen-21-yl]oxy]-3,4,5-trihydroxybenzoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/80ac57f0-8607-11ee-b612-9db85cacc209.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.15% | 91.11% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 94.92% | 94.42% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 94.48% | 83.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.37% | 99.15% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.03% | 99.23% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 92.34% | 95.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.27% | 86.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.05% | 91.49% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.03% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.02% | 95.56% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 89.67% | 89.63% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 89.60% | 96.09% |
CHEMBL3194 | P02766 | Transthyretin | 87.42% | 90.71% |
CHEMBL2581 | P07339 | Cathepsin D | 87.25% | 98.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.62% | 91.19% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.95% | 97.09% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 84.37% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.60% | 99.17% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 83.15% | 97.33% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 82.62% | 97.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.60% | 93.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.37% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Macaranga sinensis |
PubChem | 102061738 |
LOTUS | LTS0135330 |
wikiData | Q105113812 |