2-[3-[5-[4,5-dihydroxy-6-methyl-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-16-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-7-hydroxy-6-methylheptan-3-one
Internal ID | 5efa9796-d83b-4219-a46d-cf357cbf015a |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | 2-[3-[5-[4,5-dihydroxy-6-methyl-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-16-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-7-hydroxy-6-methylheptan-3-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3CCC4(C(C3)CCC5C4CCC6(C5CC(C6C(C)C(=O)CCC(C)CO)O)C)C)CO)OC7C(C(C(CO7)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3CCC4(C(C3)CCC5C4CCC6(C5CC(C6C(C)C(=O)CCC(C)CO)O)C)C)CO)OC7C(C(C(CO7)O)O)O)O)O |
InChI | InChI=1S/C44H74O17/c1-19(16-45)6-9-27(47)20(2)31-28(48)15-26-24-8-7-22-14-23(10-12-43(22,4)25(24)11-13-44(26,31)5)58-41-37(55)35(53)38(30(17-46)59-41)60-42-39(34(52)32(50)21(3)57-42)61-40-36(54)33(51)29(49)18-56-40/h19-26,28-42,45-46,48-55H,6-18H2,1-5H3 |
InChI Key | FEJQPEKPBNLXKM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C44H74O17 |
Molecular Weight | 875.00 g/mol |
Exact Mass | 874.49260089 g/mol |
Topological Polar Surface Area (TPSA) | 275.00 Ų |
XlogP | 0.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.35% | 96.09% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 97.29% | 95.58% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.46% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.14% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.32% | 97.09% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 95.04% | 96.38% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 93.08% | 96.77% |
CHEMBL237 | P41145 | Kappa opioid receptor | 92.75% | 98.10% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.35% | 96.61% |
CHEMBL233 | P35372 | Mu opioid receptor | 92.00% | 97.93% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.32% | 100.00% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 88.98% | 98.05% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 88.85% | 95.93% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.24% | 89.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.67% | 91.19% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.73% | 94.45% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 86.49% | 89.05% |
CHEMBL2581 | P07339 | Cathepsin D | 86.25% | 98.95% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 85.81% | 97.86% |
CHEMBL220 | P22303 | Acetylcholinesterase | 85.77% | 94.45% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.49% | 95.89% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 85.30% | 97.50% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.87% | 92.50% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.86% | 96.21% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 82.88% | 98.46% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 82.74% | 95.36% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.56% | 96.47% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 82.31% | 93.18% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.13% | 90.71% |
CHEMBL5028 | O14672 | ADAM10 | 82.11% | 97.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.09% | 100.00% |
CHEMBL202 | P00374 | Dihydrofolate reductase | 82.06% | 89.92% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 81.43% | 99.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.25% | 100.00% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.07% | 98.75% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 81.02% | 82.50% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 80.92% | 97.29% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum abutiloides |
PubChem | 85221045 |
LOTUS | LTS0247053 |
wikiData | Q104993995 |