2-[6-[[(1R,19R,21S,22R,23R)-6,7,8,11,12,13,22-heptahydroxy-3,16-dioxo-21-(3,4,5-trihydroxybenzoyl)oxy-2,17,20-trioxatetracyclo[17.3.1.04,9.010,15]tricosa-4,6,8,10,12,14-hexaen-23-yl]oxycarbonyl]-2,3,4-trihydroxyphenyl]-3,4,5-trihydroxybenzoic acid
Internal ID | 62a883ba-2ea0-4efd-8f47-b55aefa0eec6 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | 2-[6-[[(1R,19R,21S,22R,23R)-6,7,8,11,12,13,22-heptahydroxy-3,16-dioxo-21-(3,4,5-trihydroxybenzoyl)oxy-2,17,20-trioxatetracyclo[17.3.1.04,9.010,15]tricosa-4,6,8,10,12,14-hexaen-23-yl]oxycarbonyl]-2,3,4-trihydroxyphenyl]-3,4,5-trihydroxybenzoic acid |
SMILES (Canonical) | C1C2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)OC(=O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C(=O)O1)O)O)O)O)O)O)OC(=O)C6=CC(=C(C(=C6C7=C(C(=C(C=C7C(=O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)OC(=O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C(=O)O1)O)O)O)O)O)O)OC(=O)C6=CC(=C(C(=C6C7=C(C(=C(C=C7C(=O)O)O)O)O)O)O)O |
InChI | InChI=1S/C41H30O27/c42-13-1-8(2-14(43)24(13)48)37(60)68-41-33(57)35-34(66-39(62)11-5-17(46)27(51)31(55)22(11)20-9(36(58)59)3-15(44)25(49)29(20)53)19(65-41)7-64-38(61)10-4-16(45)26(50)30(54)21(10)23-12(40(63)67-35)6-18(47)28(52)32(23)56/h1-6,19,33-35,41-57H,7H2,(H,58,59)/t19-,33-,34-,35-,41+/m1/s1 |
InChI Key | OPGOQMMYBSLCLK-YLONXCKZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C41H30O27 |
Molecular Weight | 954.70 g/mol |
Exact Mass | 954.09744568 g/mol |
Topological Polar Surface Area (TPSA) | 475.00 Ų |
XlogP | 1.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.55% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.28% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 93.05% | 98.95% |
CHEMBL3194 | P02766 | Transthyretin | 92.18% | 90.71% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 92.08% | 83.00% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 90.28% | 94.42% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.93% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.58% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.54% | 99.17% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 87.73% | 96.38% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 87.59% | 95.64% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.79% | 86.33% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 85.24% | 96.00% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 84.77% | 95.17% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 84.62% | 97.36% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.49% | 92.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.38% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.29% | 94.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.01% | 96.21% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.97% | 91.19% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.89% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.57% | 99.15% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 82.46% | 89.34% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.43% | 93.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.21% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Geranium thunbergii |
Glycine max |
PubChem | 23258819 |
LOTUS | LTS0095812 |
wikiData | Q105280822 |