[(1S,3R,5R,6S,7R)-6-hydroxy-8-methyl-7-(1-methylpyrrole-2-carbonyl)oxy-8-azabicyclo[3.2.1]octan-3-yl] 1-methylpyrrole-2-carboxylate
| Internal ID | 095ccb73-7fba-47d3-8f38-4dd3c0ce1ec5 |
| Taxonomy | Alkaloids and derivatives > Tropane alkaloids |
| IUPAC Name | [(1S,3R,5R,6S,7R)-6-hydroxy-8-methyl-7-(1-methylpyrrole-2-carbonyl)oxy-8-azabicyclo[3.2.1]octan-3-yl] 1-methylpyrrole-2-carboxylate |
| SMILES (Canonical) | CN1C=CC=C1C(=O)OC2CC3C(C(C(C2)N3C)OC(=O)C4=CC=CN4C)O |
| SMILES (Isomeric) | CN1C=CC=C1C(=O)O[C@@H]2C[C@@H]3[C@@H]([C@@H]([C@H](C2)N3C)OC(=O)C4=CC=CN4C)O |
| InChI | InChI=1S/C20H25N3O5/c1-21-8-4-6-13(21)19(25)27-12-10-15-17(24)18(16(11-12)23(15)3)28-20(26)14-7-5-9-22(14)2/h4-9,12,15-18,24H,10-11H2,1-3H3/t12-,15-,16+,17+,18-/m1/s1 |
| InChI Key | WIKSORYWEPWYTL-UWLPGLTFSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.17942091 g/mol |
| Topological Polar Surface Area (TPSA) | 85.90 Ų |
| XlogP | 1.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.62% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.06% | 98.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.13% | 90.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.28% | 95.56% |
| CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 81.51% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.39% | 97.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.46% | 91.19% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.42% | 95.89% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.08% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162925630 |
| LOTUS | LTS0070352 |
| wikiData | Q105306309 |