(8-Methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-phenylpropanoate
| Internal ID | b66ce554-0b8c-4862-94e1-10516caf722d |
| Taxonomy | Alkaloids and derivatives > Tropane alkaloids |
| IUPAC Name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 2-phenylpropanoate |
| SMILES (Canonical) | CC(C1=CC=CC=C1)C(=O)OC2CC3CCC(C2)N3C |
| SMILES (Isomeric) | CC(C1=CC=CC=C1)C(=O)OC2CC3CCC(C2)N3C |
| InChI | InChI=1S/C17H23NO2/c1-12(13-6-4-3-5-7-13)17(19)20-16-10-14-8-9-15(11-16)18(14)2/h3-7,12,14-16H,8-11H2,1-2H3 |
| InChI Key | ABQUDUAAINLKTQ-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.172878976 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 3.10 |
| SCHEMBL22394825 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.57% | 96.09% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 96.45% | 94.62% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 96.23% | 94.23% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 94.65% | 94.08% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.18% | 98.95% |
| CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 91.55% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.59% | 95.56% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.43% | 90.17% |
| CHEMBL5028 | O14672 | ADAM10 | 86.94% | 97.50% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.22% | 91.19% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 85.30% | 83.82% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.20% | 96.47% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.40% | 97.25% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.99% | 86.33% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.12% | 93.56% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.44% | 82.69% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.25% | 97.09% |
| CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 80.67% | 94.97% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.08% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Datura stramonium |
| PubChem | 10401092 |
| LOTUS | LTS0234891 |
| wikiData | Q104908764 |