8-Methoxybonducellin
Internal ID | d3ba40b8-3329-4fe3-ac70-7b55d064b4bc |
Taxonomy | Phenylpropanoids and polyketides > Homoisoflavonoids |
IUPAC Name | (3E)-7-hydroxy-8-methoxy-3-[(4-methoxyphenyl)methylidene]chromen-4-one |
SMILES (Canonical) | COC1=CC=C(C=C1)C=C2COC3=C(C2=O)C=CC(=C3OC)O |
SMILES (Isomeric) | COC1=CC=C(C=C1)/C=C/2\COC3=C(C2=O)C=CC(=C3OC)O |
InChI | InChI=1S/C18H16O5/c1-21-13-5-3-11(4-6-13)9-12-10-23-17-14(16(12)20)7-8-15(19)18(17)22-2/h3-9,19H,10H2,1-2H3/b12-9+ |
InChI Key | WOXQROZUZURVHX-FMIVXFBMSA-N |
Popularity | 2 references in papers |
Molecular Formula | C18H16O5 |
Molecular Weight | 312.30 g/mol |
Exact Mass | 312.09977361 g/mol |
Topological Polar Surface Area (TPSA) | 65.00 Ų |
XlogP | 2.90 |
90996-27-3 |
(E)-7-hydroxy-8-methoxy-3-(4-methoxybenzylidene)chroman-4-one |
E-8-METHOXYBONDUCELLIN |
CHEMBL2408720 |
AKOS040734105 |
FS-9147 |
(3E)-7-hydroxy-8-methoxy-3-[(4-methoxyphenyl)methylene]chroman-4-one |
(3E)-7-hydroxy-8-methoxy-3-[(4-methoxyphenyl)methylidene]chromen-4-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.47% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.09% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.87% | 91.49% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 95.03% | 96.12% |
CHEMBL4208 | P20618 | Proteasome component C5 | 93.26% | 90.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.11% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 88.93% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.55% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.63% | 99.23% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 84.58% | 80.78% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.52% | 89.00% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 83.66% | 90.24% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.83% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.37% | 96.09% |
CHEMBL1907 | P15144 | Aminopeptidase N | 80.90% | 93.31% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 80.28% | 82.67% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 80.09% | 95.53% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Caesalpinia pulcherrima |
Microdesmis keayana |
PubChem | 73353608 |
LOTUS | LTS0227960 |
wikiData | Q105309738 |