8-Methoxy-2-(8-methoxy-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-7-yl)-6-methylnaphthalen-1-ol
| Internal ID | f3adce7a-2097-4c32-b858-eb372f7832bb |
| Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives > Naphthylisoquinolines |
| IUPAC Name | 8-methoxy-2-(8-methoxy-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-7-yl)-6-methylnaphthalen-1-ol |
| SMILES (Canonical) | CC1CC2=C(C(N1)C)C(=C(C=C2)C3=C(C4=C(C=C3)C=C(C=C4OC)C)O)OC |
| SMILES (Isomeric) | CC1CC2=C(C(N1)C)C(=C(C=C2)C3=C(C4=C(C=C3)C=C(C=C4OC)C)O)OC |
| InChI | InChI=1S/C24H27NO3/c1-13-10-16-6-8-18(23(26)22(16)20(11-13)27-4)19-9-7-17-12-14(2)25-15(3)21(17)24(19)28-5/h6-11,14-15,25-26H,12H2,1-5H3 |
| InChI Key | ZYBIVXYBCOCORX-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.19909372 g/mol |
| Topological Polar Surface Area (TPSA) | 50.70 Ų |
| XlogP | 5.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.09% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.73% | 96.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.14% | 91.49% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 93.76% | 96.95% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.06% | 98.95% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.10% | 92.94% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.87% | 94.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.06% | 90.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.20% | 99.17% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 88.58% | 91.79% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 88.35% | 95.56% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.25% | 95.56% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.73% | 89.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.42% | 86.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.28% | 97.09% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.99% | 97.21% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 84.14% | 95.12% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.22% | 98.75% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 81.67% | 93.18% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 81.45% | 96.39% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.77% | 96.67% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.65% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Taxus brevifolia |
| Triphyophyllum peltatum |
| PubChem | 85189748 |
| LOTUS | LTS0151157 |
| wikiData | Q105373128 |