8-Ketoylangenol
Internal ID | cb1d109f-395e-491c-a321-d753febf12f8 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | (1R,5S,6R)-8-(hydroxymethyl)-2-methyl-5-propan-2-yltricyclo[4.4.0.02,7]dec-8-en-4-one |
SMILES (Canonical) | CC(C)C1C2C3CC=C(C2C3(CC1=O)C)CO |
SMILES (Isomeric) | CC(C)[C@H]1[C@@H]2[C@H]3CC=C(C2C3(CC1=O)C)CO |
InChI | InChI=1S/C15H22O2/c1-8(2)12-11(17)6-15(3)10-5-4-9(7-16)14(15)13(10)12/h4,8,10,12-14,16H,5-7H2,1-3H3/t10-,12-,13+,14?,15?/m1/s1 |
InChI Key | HMEPWRJNLAEXQI-GXJGTPHTSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C15H22O2 |
Molecular Weight | 234.33 g/mol |
Exact Mass | 234.161979940 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 1.60 |
CHEMBL506667 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.84% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.71% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.04% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 94.12% | 98.95% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.24% | 94.75% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.15% | 94.45% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 87.94% | 83.82% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.40% | 95.56% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.49% | 93.99% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.46% | 100.00% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 85.32% | 90.08% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.57% | 90.00% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 83.34% | 97.29% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 82.35% | 97.79% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.66% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Brachylaena huillensis |
PubChem | 44567106 |
LOTUS | LTS0121319 |
wikiData | Q105030476 |