8-(Hydroxymethyl)-4b,8-dimethyl-2-propan-2-yl-5,6,7,8a-tetrahydrophenanthren-3-ol
Internal ID | 658c6a11-978a-47f5-bed4-cb3ee684ae92 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | 8-(hydroxymethyl)-4b,8-dimethyl-2-propan-2-yl-5,6,7,8a-tetrahydrophenanthren-3-ol |
SMILES (Canonical) | CC(C)C1=C(C=C2C(=C1)C=CC3C2(CCCC3(C)CO)C)O |
SMILES (Isomeric) | CC(C)C1=C(C=C2C(=C1)C=CC3C2(CCCC3(C)CO)C)O |
InChI | InChI=1S/C20H28O2/c1-13(2)15-10-14-6-7-18-19(3,12-21)8-5-9-20(18,4)16(14)11-17(15)22/h6-7,10-11,13,18,21-22H,5,8-9,12H2,1-4H3 |
InChI Key | NVXMKMSYGAERCC-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H28O2 |
Molecular Weight | 300.40 g/mol |
Exact Mass | 300.208930132 g/mol |
Topological Polar Surface Area (TPSA) | 40.50 Ų |
XlogP | 5.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.24% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 93.51% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.21% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.37% | 94.45% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.12% | 99.15% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.00% | 97.25% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.35% | 90.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.20% | 95.89% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.40% | 96.77% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.36% | 92.62% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.02% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.10% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.05% | 100.00% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.97% | 90.24% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.66% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.47% | 86.33% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 80.29% | 98.05% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cryptomeria japonica |
PubChem | 85434788 |
LOTUS | LTS0113206 |
wikiData | Q105186470 |