8-Hydroxygenistein
| Internal ID | 997f2fc8-28fb-4cb7-866f-a47bb3f1659c |
| Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflav-2-enes > Isoflavones |
| IUPAC Name | 5,7,8-trihydroxy-3-(4-hydroxyphenyl)chromen-4-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H10O6/c16-8-3-1-7(2-4-8)9-6-21-15-12(13(9)19)10(17)5-11(18)14(15)20/h1-6,16-18,20H |
| InChI Key | ZKZCRGBCWBCSNJ-UHFFFAOYSA-N |
| Popularity | 16 references in papers |
| Molecular Formula | C15H10O6 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.04773803 g/mol |
| Topological Polar Surface Area (TPSA) | 107.00 Ų |
| XlogP | 2.30 |
| 13539-27-0 |
| 5,7,8-trihydroxy-3-(4-hydroxyphenyl)chromen-4-one |
| 5,7,8-Trihydroxy-3-(4-hydroxyphenyl)-4H-chromen-4-one |
| BRN 1294503 |
| 4',5,7,8-Tetrahydroxyisoflavone |
| Isoflavone, 4',5,7,8-tetrahydroxy- |
| 3-(4-Hydroxyphenyl)-5,7,8-trihydroxy-4H-1-benzopyran-4-one |
| SCHEMBL572094 |
| DTXSID40159329 |
| 4H-1-Benzopyran-4-one, 3-(4-hydroxyphenyl)-5,7,8-trihydroxy- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.53% | 91.11% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 94.90% | 98.35% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.86% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.47% | 94.00% |
| CHEMBL3194 | P02766 | Transthyretin | 92.44% | 90.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.03% | 89.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.83% | 99.15% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 87.61% | 91.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.89% | 86.33% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 86.09% | 91.38% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.46% | 95.56% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 85.35% | 95.64% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 81.65% | 95.78% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.38% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 5492944 |
| LOTUS | LTS0166032 |
| wikiData | Q104945703 |