8-Hydroxy-9,10-dimethoxyanthracene-2-carbaldehyde
| Internal ID | 67cd8b39-c8c7-4e67-a110-08dde4d04118 |
| Taxonomy | Benzenoids > Anthracenes |
| IUPAC Name | 8-hydroxy-9,10-dimethoxyanthracene-2-carbaldehyde |
| SMILES (Canonical) | COC1=C2C=CC(=CC2=C(C3=C1C=CC=C3O)OC)C=O |
| SMILES (Isomeric) | COC1=C2C=CC(=CC2=C(C3=C1C=CC=C3O)OC)C=O |
| InChI | InChI=1S/C17H14O4/c1-20-16-11-7-6-10(9-18)8-13(11)17(21-2)15-12(16)4-3-5-14(15)19/h3-9,19H,1-2H3 |
| InChI Key | VLJUCDZJBABGOC-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.08920892 g/mol |
| Topological Polar Surface Area (TPSA) | 55.80 Ų |
| XlogP | 3.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.45% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.17% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.80% | 91.11% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 93.56% | 98.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.88% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.98% | 98.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.89% | 98.95% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.10% | 99.15% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.72% | 95.50% |
| CHEMBL3959 | P16083 | Quinone reductase 2 | 84.86% | 89.49% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.31% | 94.73% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.96% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.66% | 99.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.42% | 96.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.24% | 99.23% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.82% | 94.45% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.78% | 94.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.64% | 89.00% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.54% | 80.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cichorium intybus |
| Cichorium pumilum |
| Hieracium gymnocephalum |
| Morinda lucida |
| Saussurea petrovii |
| Saussurea ussuriensis |
| Tolpis webbii |
| PubChem | 163029200 |
| LOTUS | LTS0071440 |
| wikiData | Q104888770 |