8-Hydroxy-7-methoxy-6-phenylphenalen-1-one
| Internal ID | 016d08ab-1d55-4e60-bcd6-0916ee7bf31e |
| Taxonomy | Benzenoids > Naphthalenes > Phenylnaphthalenes |
| IUPAC Name | 8-hydroxy-7-methoxy-6-phenylphenalen-1-one |
| SMILES (Canonical) | COC1=C(C=C2C(=O)C=CC3=C2C1=C(C=C3)C4=CC=CC=C4)O |
| SMILES (Isomeric) | COC1=C(C=C2C(=O)C=CC3=C2C1=C(C=C3)C4=CC=CC=C4)O |
| InChI | InChI=1S/C20H14O3/c1-23-20-17(22)11-15-16(21)10-8-13-7-9-14(19(20)18(13)15)12-5-3-2-4-6-12/h2-11,22H,1H3 |
| InChI Key | FRNMROBOHVJVGF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H14O3 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.094294304 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 4.40 |
| 8-Hydroxy-7-methoxy-6-phenylphenalen-1-one |
| 8-Hydroxy-7-methoxy-6-phenyl-phenalen-1-one |
| 8-hydroxy-7-methoxy-6-phenyl-1H-phenalen-1-one |
| 1H-phenalen-1-one, 8-hydroxy-7-methoxy-6-phenyl- |
| InChI=1/C20H14O3/c1-23-20-17(22)11-15-16(21)10-8-13-7-9-14(19(20)18(13)15)12-5-3-2-4-6-12/h2-11,22H,1H |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.59% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.15% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.47% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.90% | 86.33% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.04% | 99.15% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 88.52% | 93.31% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 88.25% | 96.67% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.28% | 94.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 83.81% | 91.49% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.57% | 93.99% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.30% | 99.17% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.72% | 99.23% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.41% | 96.09% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.02% | 95.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.61% | 89.00% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.97% | 80.78% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.40% | 98.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.35% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Clausena excavata |
| Ensete ventricosum |
| Strelitzia reginae |
| PubChem | 636807 |
| LOTUS | LTS0083717 |
| wikiData | Q105314286 |