8-Hydroxy-5-methoxy-3-phenylfuro[3,2-b]chromen-2-one
| Internal ID | 8970487e-723f-47dc-8cc9-7f97ea25d448 |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Furanocoumarins |
| IUPAC Name | 8-hydroxy-5-methoxy-3-phenylfuro[3,2-b]chromen-2-one |
| SMILES (Canonical) | COC1=C2C(=C(C=C1)O)C=C3C(=C(C(=O)O3)C4=CC=CC=C4)O2 |
| SMILES (Isomeric) | COC1=C2C(=C(C=C1)O)C=C3C(=C(C(=O)O3)C4=CC=CC=C4)O2 |
| InChI | InChI=1S/C18H12O5/c1-21-13-8-7-12(19)11-9-14-17(23-16(11)13)15(18(20)22-14)10-5-3-2-4-6-10/h2-9,19H,1H3 |
| InChI Key | JMVRQHLTUBNMPU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H12O5 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.06847348 g/mol |
| Topological Polar Surface Area (TPSA) | 65.00 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
![2D Structure of 8-Hydroxy-5-methoxy-3-phenylfuro[3,2-b]chromen-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/8-hydroxy-5-methoxy-3-phenylfuro32-bchromen-2-one.jpg "2D Structure of 8-Hydroxy-5-methoxy-3-phenylfuro[3,2-b]chromen-2-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.96% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.68% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.32% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.25% | 98.95% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.16% | 99.15% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.55% | 94.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.47% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.98% | 89.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 89.04% | 90.20% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.81% | 95.50% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 86.39% | 91.49% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.86% | 98.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.43% | 99.17% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.27% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 102384477 |
| LOTUS | LTS0074577 |
| wikiData | Q105131696 |