8-Hydroxy-3-pentadec-6-enyl-3,4-dihydroisochromen-1-one
Internal ID | 71d8ba1a-346f-46d5-beab-3a9baeed7a44 |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 2-benzopyrans |
IUPAC Name | 8-hydroxy-3-pentadec-6-enyl-3,4-dihydroisochromen-1-one |
SMILES (Canonical) | CCCCCCCCC=CCCCCCC1CC2=C(C(=CC=C2)O)C(=O)O1 |
SMILES (Isomeric) | CCCCCCCCC=CCCCCCC1CC2=C(C(=CC=C2)O)C(=O)O1 |
InChI | InChI=1S/C24H36O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-21-19-20-16-15-18-22(25)23(20)24(26)27-21/h9-10,15-16,18,21,25H,2-8,11-14,17,19H2,1H3 |
InChI Key | GCSUJEGOLAPNMD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H36O3 |
Molecular Weight | 372.50 g/mol |
Exact Mass | 372.26644501 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 8.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.97% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.88% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.88% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.64% | 99.17% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.18% | 93.99% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.96% | 94.73% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.47% | 99.23% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 90.36% | 91.49% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 90.02% | 92.08% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.74% | 93.56% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 88.42% | 95.62% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.60% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.33% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.74% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.23% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.45% | 95.89% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 84.11% | 97.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.49% | 97.09% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.98% | 96.95% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 80.46% | 96.37% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ginkgo biloba |
PubChem | 129684381 |
LOTUS | LTS0267197 |
wikiData | Q105006453 |