8-hydroxy-3-methyl-3,4,5,6-tetrahydro-2H-benzo[a]anthracene-1,7,12-trione
| Internal ID | 8ab0e874-6274-4d54-a974-84f609862aa6 |
| Taxonomy | Benzenoids > Anthracenes > Anthraquinones |
| IUPAC Name | 8-hydroxy-3-methyl-3,4,5,6-tetrahydro-2H-benzo[a]anthracene-1,7,12-trione |
| SMILES (Canonical) | CC1CC2=C(C(=O)C1)C3=C(CC2)C(=O)C4=C(C3=O)C=CC=C4O |
| SMILES (Isomeric) | CC1CC2=C(C(=O)C1)C3=C(CC2)C(=O)C4=C(C3=O)C=CC=C4O |
| InChI | InChI=1S/C19H16O4/c1-9-7-10-5-6-12-17(15(10)14(21)8-9)19(23)11-3-2-4-13(20)16(11)18(12)22/h2-4,9,20H,5-8H2,1H3 |
| InChI Key | AZMGJNKEBCESNI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H16O4 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.10485899 g/mol |
| Topological Polar Surface Area (TPSA) | 71.40 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
![2D Structure of 8-hydroxy-3-methyl-3,4,5,6-tetrahydro-2H-benzo[a]anthracene-1,7,12-trione](https://plantaedb.com/storage/docs/compounds/2023/11/8-hydroxy-3-methyl-3456-tetrahydro-2h-benzoaanthracene-1712-trione.jpg "2D Structure of 8-hydroxy-3-methyl-3,4,5,6-tetrahydro-2H-benzo[a]anthracene-1,7,12-trione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.35% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.60% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.02% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.27% | 99.23% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.26% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.16% | 96.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.28% | 89.00% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 87.90% | 95.62% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.96% | 97.09% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.50% | 93.03% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.72% | 100.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.04% | 99.15% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.87% | 93.40% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.77% | 98.75% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 81.18% | 96.67% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.13% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162990065 |
| LOTUS | LTS0196630 |
| wikiData | Q103816584 |