8-hydroxy-1H-quinazolin-4-one
| Internal ID | ccd2608e-2fef-4973-bd9d-070e1ec29600 |
| Taxonomy | Organoheterocyclic compounds > Diazanaphthalenes > Benzodiazines > Quinazolines |
| IUPAC Name | 8-hydroxy-1H-quinazolin-4-one |
| SMILES (Canonical) | C1=CC2=C(C(=C1)O)NC=NC2=O |
| SMILES (Isomeric) | C1=CC2=C(C(=C1)O)NC=NC2=O |
| InChI | InChI=1S/C8H6N2O2/c11-6-3-1-2-5-7(6)9-4-10-8(5)12/h1-4,11H,(H,9,10,12) |
| InChI Key | MQDRJIKLAZSSLF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.042927438 g/mol |
| Topological Polar Surface Area (TPSA) | 61.70 Ų |
| XlogP | 0.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 96.86% | 94.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.76% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.58% | 91.11% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.52% | 99.23% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.04% | 99.15% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.89% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.85% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.67% | 98.75% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 85.25% | 91.49% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 85.23% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.98% | 94.45% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 82.79% | 90.08% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.92% | 94.73% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.49% | 93.99% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.39% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 18354618 |
| LOTUS | LTS0218906 |
| wikiData | Q105169925 |