8-Hydroxy-1-methoxy-3-methylanthraquinone
| Internal ID | 82090080-b9b8-4780-b9c6-9667a4813582 |
| Taxonomy | Benzenoids > Anthracenes > Anthraquinones |
| IUPAC Name | 8-hydroxy-1-methoxy-3-methylanthracene-9,10-dione |
| SMILES (Canonical) | CC1=CC2=C(C(=C1)OC)C(=O)C3=C(C2=O)C=CC=C3O |
| SMILES (Isomeric) | CC1=CC2=C(C(=C1)OC)C(=O)C3=C(C2=O)C=CC=C3O |
| InChI | InChI=1S/C16H12O4/c1-8-6-10-14(12(7-8)20-2)16(19)13-9(15(10)18)4-3-5-11(13)17/h3-7,17H,1-2H3 |
| InChI Key | KVRUANCWPQJDMF-UHFFFAOYSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.07355886 g/mol |
| Topological Polar Surface Area (TPSA) | 63.60 Ų |
| XlogP | 3.40 |
| 67116-22-7 |
| 8-hydroxy-1-methoxy-3-methylanthracene-9,10-dione |
| 1-O-Methylchrysophanol |
| CHEMBL454477 |
| SCHEMBL8930315 |
| DTXSID20540019 |
| CHEBI:174530 |
| 1-methoxy-3-methyl-8-hydroxy-anthraquinone |
| 8-HYDROXY-1-METHOXY-3-METHYL-9,10-DIHYDROANTHRACENE-9,10-DIONE |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.88% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.75% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.93% | 91.49% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.26% | 98.75% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.83% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.94% | 89.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.89% | 91.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.76% | 99.15% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.94% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.61% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.54% | 94.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.47% | 94.73% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.70% | 93.03% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 84.71% | 96.67% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.54% | 90.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.67% | 94.75% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 81.89% | 91.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 81.31% | 93.31% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.75% | 96.00% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 80.47% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Karwinskia parvifolia |
| Senna obtusifolia |
| PubChem | 13412789 |
| NPASS | NPC1268 |
| ChEMBL | CHEMBL454477 |
| LOTUS | LTS0219974 |
| wikiData | Q82415878 |