8-Formyl-2,5,7-trihydroxy-6-methylflavanone
| Internal ID | 49e3173a-faf0-4a3a-b4fd-a7fc926e4124 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Hydroxyflavonoids > 7-hydroxyflavonoids |
| IUPAC Name | 2,5,7-trihydroxy-6-methyl-4-oxo-2-phenyl-3H-chromene-8-carbaldehyde |
| SMILES (Canonical) | CC1=C(C(=C2C(=C1O)C(=O)CC(O2)(C3=CC=CC=C3)O)C=O)O |
| SMILES (Isomeric) | CC1=C(C(=C2C(=C1O)C(=O)CC(O2)(C3=CC=CC=C3)O)C=O)O |
| InChI | InChI=1S/C17H14O6/c1-9-14(20)11(8-18)16-13(15(9)21)12(19)7-17(22,23-16)10-5-3-2-4-6-10/h2-6,8,20-22H,7H2,1H3 |
| InChI Key | PTQOJHUHQGPAFD-UHFFFAOYSA-N |
| Popularity | 150 references in papers |
| Molecular Formula | C17H14O6 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.07903816 g/mol |
| Topological Polar Surface Area (TPSA) | 104.00 Ų |
| XlogP | 2.40 |
| 149250-49-7 |
| 8-formyl-2,5,7-trihydroxy-6-methyl-flavanone |
| RefChem:910602 |
| 3,4-Dihydro-2,5,7-trihydroxy-6-methyl-4-oxo-2-phenyl-2H-1-benzopyran-8-carboxaldehyde |
| 8-Formyl-2,5,7-trihydroxy-6-methylflavanone |
| 2H-1-Benzopyran-8-carboxaldehyde, 3,4-dihydro-2,5,7-trihydroxy-6-methyl-4-oxo-2-phenyl- |
| SCHEMBL1527450 |
| DTXSID40933601 |
| 2,5,7-Trihydroxy-6-methyl-4-oxo-2-phenyl-3,4-dihydro-2H-1-benzopyran-8-carbaldehyde |
| 2,5,7-trihydroxy-6-methyl-4-oxo-2-phenyl-3H-chromene-8-carbaldehyde |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.82% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.95% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.37% | 98.95% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 86.81% | 98.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.07% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.86% | 99.23% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.23% | 94.62% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 83.51% | 94.08% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.81% | 94.73% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.36% | 86.33% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.55% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Desmos chinensis |
| PubChem | 10018499 |
| LOTUS | LTS0071636 |
| wikiData | Q82909431 |