8-Epideoxyloganin
Internal ID | 1d248491-a0ab-42d2-a69b-6e5119b7dc05 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | methyl (1S,4aS,7R,7aR)-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
SMILES (Canonical) | CC1CCC2C1C(OC=C2C(=O)OC)OC3C(C(C(C(O3)CO)O)O)O |
SMILES (Isomeric) | C[C@@H]1CC[C@H]2[C@@H]1[C@@H](OC=C2C(=O)OC)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
InChI | InChI=1S/C17H26O9/c1-7-3-4-8-9(15(22)23-2)6-24-16(11(7)8)26-17-14(21)13(20)12(19)10(5-18)25-17/h6-8,10-14,16-21H,3-5H2,1-2H3/t7-,8-,10-,11-,12-,13+,14-,16+,17+/m1/s1 |
InChI Key | KMHXLGLJTQHEIM-OBFZKGLGSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C17H26O9 |
Molecular Weight | 374.40 g/mol |
Exact Mass | 374.15768240 g/mol |
Topological Polar Surface Area (TPSA) | 135.00 Ų |
XlogP | 0.00 |
CHEBI:2315 |
CHEMBL2048533 |
LMPR0102070020 |
methyl (1S,4aS,7R,7aR)-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
Q27105625 |
![2D Structure of 8-Epideoxyloganin 2D Structure of 8-Epideoxyloganin](https://plantaedb.com/storage/docs/compounds/2023/11/8-epideoxyloganin.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.89% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.97% | 91.11% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.67% | 83.82% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.70% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 90.65% | 98.95% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 87.60% | 92.50% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 84.43% | 96.61% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.40% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.14% | 96.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.11% | 94.80% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.88% | 94.73% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.29% | 85.14% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.58% | 94.33% |
CHEMBL5028 | O14672 | ADAM10 | 80.00% | 97.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.00% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Argylia radiata |
Verbena officinalis |
PubChem | 443331 |
LOTUS | LTS0153341 |
wikiData | Q27105625 |