8-Demethyllatifolin
Internal ID | 221f1596-d286-4e6e-95e4-471c5102cb4e |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 7-O-methylated flavonoids |
IUPAC Name | 5-hydroxy-2-(4-hydroxyphenyl)-3,7-dimethoxy-6-methylchromen-4-one |
SMILES (Canonical) | CC1=C(C=C2C(=C1O)C(=O)C(=C(O2)C3=CC=C(C=C3)O)OC)OC |
SMILES (Isomeric) | CC1=C(C=C2C(=C1O)C(=O)C(=C(O2)C3=CC=C(C=C3)O)OC)OC |
InChI | InChI=1S/C18H16O6/c1-9-12(22-2)8-13-14(15(9)20)16(21)18(23-3)17(24-13)10-4-6-11(19)7-5-10/h4-8,19-20H,1-3H3 |
InChI Key | DTOUWUNQCABKEZ-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C18H16O6 |
Molecular Weight | 328.30 g/mol |
Exact Mass | 328.09468823 g/mol |
Topological Polar Surface Area (TPSA) | 85.20 Ų |
XlogP | 3.50 |
5,4'-Dihydroxy-3,7-dimethoxy-6-methylflavone |
LMPK12112685 |
5-hydroxy-2-(4-hydroxyphenyl)-3,7-dimethoxy-6-methyl-chromen-4-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.40% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.78% | 89.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.38% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 92.59% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.87% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.67% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.55% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.24% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.16% | 94.45% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.80% | 99.15% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 85.70% | 95.64% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.07% | 90.71% |
CHEMBL3194 | P02766 | Transthyretin | 81.93% | 90.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.27% | 94.73% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.04% | 99.23% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.20% | 94.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Abies nephrolepis |
Abies spectabilis |
Alluaudia dumosa |
Kalmia latifolia |
Leptospermum laevigatum |
PubChem | 14353449 |
LOTUS | LTS0079338 |
wikiData | Q104988958 |