[8]-Dehydroshogaol
Internal ID | 1ead22e0-4d0c-452a-ab1a-743372f3c765 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives |
IUPAC Name | (1E,4E)-1-(4-hydroxy-3-methoxyphenyl)dodeca-1,4-dien-3-one |
SMILES (Canonical) | CCCCCCCC=CC(=O)C=CC1=CC(=C(C=C1)O)OC |
SMILES (Isomeric) | CCCCCCC/C=C/C(=O)/C=C/C1=CC(=C(C=C1)O)OC |
InChI | InChI=1S/C19H26O3/c1-3-4-5-6-7-8-9-10-17(20)13-11-16-12-14-18(21)19(15-16)22-2/h9-15,21H,3-8H2,1-2H3/b10-9+,13-11+ |
InChI Key | WTJRJJFXDZXSLU-SNMPHBPQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H26O3 |
Molecular Weight | 302.40 g/mol |
Exact Mass | 302.18819469 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 5.70 |
CHEBI:191579 |
(1E,4E)-1-(4-hydroxy-3-methoxyphenyl)dodeca-1,4-dien-3-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.92% | 99.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.62% | 91.11% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.55% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.33% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.10% | 96.09% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 94.20% | 92.08% |
CHEMBL2581 | P07339 | Cathepsin D | 92.66% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.87% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 89.20% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.11% | 89.00% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 87.07% | 80.78% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.07% | 89.62% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.00% | 96.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.30% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Zingiber officinale |
PubChem | 9796428 |
LOTUS | LTS0048902 |
wikiData | Q105312594 |