8-C-alpha-L-Arabinosylluteolin
| Internal ID | a089af93-1fce-497f-917b-723dea8c4511 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid C-glycosides > Flavonoid 8-C-glycosides |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-8-[(2S,4S,5S)-3,4,5-trihydroxyoxan-2-yl]chromen-4-one |
| SMILES (Canonical) | C1C(C(C(C(O1)C2=C(C=C(C3=C2OC(=CC3=O)C4=CC(=C(C=C4)O)O)O)O)O)O)O |
| SMILES (Isomeric) | C1[C@@H]([C@@H](C([C@@H](O1)C2=C(C=C(C3=C2OC(=CC3=O)C4=CC(=C(C=C4)O)O)O)O)O)O)O |
| InChI | InChI=1S/C20H18O10/c21-8-2-1-7(3-9(8)22)14-5-12(25)15-10(23)4-11(24)16(19(15)30-14)20-18(28)17(27)13(26)6-29-20/h1-5,13,17-18,20-24,26-28H,6H2/t13-,17-,18?,20-/m0/s1 |
| InChI Key | GJHTVUOIDXUACV-UDHZNOBRSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H18O10 |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 418.08999677 g/mol |
| Topological Polar Surface Area (TPSA) | 177.00 Ų |
| XlogP | -0.10 |
| LMPK12110472 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.47% | 91.11% |
| CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 96.33% | 91.73% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.92% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.90% | 98.95% |
| CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 95.82% | 89.23% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.48% | 91.49% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.57% | 99.15% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.61% | 95.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.04% | 90.71% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.75% | 94.00% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 86.92% | 85.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.10% | 97.09% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 85.63% | 91.38% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 84.02% | 96.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.37% | 99.23% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.16% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.04% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Mucuna sempervirens |
| PubChem | 44257909 |
| LOTUS | LTS0031688 |
| wikiData | Q105009397 |