8-(4,7-Dihydroxy-3-methoxy-9,10-dihydrophenanthren-1-yl)-6-methoxyphenanthrene-2,5-diol
| Internal ID | 6e51ad9f-1aa6-4343-a833-0368587b126e |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Phenanthrols |
| IUPAC Name | 8-(4,7-dihydroxy-3-methoxy-9,10-dihydrophenanthren-1-yl)-6-methoxyphenanthrene-2,5-diol |
| SMILES (Canonical) | COC1=C(C2=C(CCC3=C2C=CC(=C3)O)C(=C1)C4=CC(=C(C5=C4C=CC6=C5C=CC(=C6)O)O)OC)O |
| SMILES (Isomeric) | COC1=C(C2=C(CCC3=C2C=CC(=C3)O)C(=C1)C4=CC(=C(C5=C4C=CC6=C5C=CC(=C6)O)O)OC)O |
| InChI | InChI=1S/C30H24O6/c1-35-25-13-23(21-7-3-15-11-17(31)5-9-19(15)27(21)29(25)33)24-14-26(36-2)30(34)28-20-10-6-18(32)12-16(20)4-8-22(24)28/h3,5-7,9-14,31-34H,4,8H2,1-2H3 |
| InChI Key | OICWLBYGEMOZNV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H24O6 |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.15728848 g/mol |
| Topological Polar Surface Area (TPSA) | 99.40 Ų |
| XlogP | 6.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.46% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.92% | 91.49% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 98.01% | 98.35% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.70% | 94.45% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 94.37% | 91.79% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 93.02% | 89.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.06% | 86.33% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 92.03% | 91.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.54% | 98.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.96% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.84% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.00% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.50% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.26% | 99.17% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 85.97% | 92.68% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.20% | 95.78% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 85.04% | 96.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.81% | 92.62% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.49% | 95.89% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.94% | 92.94% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 82.79% | 93.31% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 82.16% | 96.67% |
| CHEMBL3085 | P43003 | Excitatory amino acid transporter 1 | 82.05% | 94.67% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.80% | 90.00% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 81.72% | 95.62% |
| CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 81.37% | 98.21% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 80.92% | 95.12% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 80.14% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pholidota chinensis |
| PubChem | 102026934 |
| LOTUS | LTS0179027 |
| wikiData | Q105192450 |