8-(4-Hydroxy-3,5-dimethoxyphenyl)-1,3,6,7-tetramethoxy-5,6,7,8-tetrahydronaphthalen-2-ol
| Internal ID | 6555831c-ff32-4ba0-88a9-ff289195bff6 |
| Taxonomy | Benzenoids > Tetralins |
| IUPAC Name | 8-(4-hydroxy-3,5-dimethoxyphenyl)-1,3,6,7-tetramethoxy-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES (Canonical) | COC1CC2=CC(=C(C(=C2C(C1OC)C3=CC(=C(C(=C3)OC)O)OC)OC)O)OC |
| SMILES (Isomeric) | COC1CC2=CC(=C(C(=C2C(C1OC)C3=CC(=C(C(=C3)OC)O)OC)OC)O)OC |
| InChI | InChI=1S/C22H28O8/c1-25-13-7-11(8-14(26-2)19(13)23)17-18-12(10-16(28-4)21(17)29-5)9-15(27-3)20(24)22(18)30-6/h7-9,16-17,21,23-24H,10H2,1-6H3 |
| InChI Key | APZMLQFLMSYDCT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H28O8 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.17841785 g/mol |
| Topological Polar Surface Area (TPSA) | 95.80 Ų |
| XlogP | 2.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.76% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.47% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.98% | 85.14% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.80% | 92.94% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.28% | 86.33% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.03% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.68% | 97.09% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.63% | 89.62% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.70% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.62% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.01% | 95.89% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 81.79% | 88.48% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 80.42% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Zanthoxylum asiaticum |
| PubChem | 162943381 |
| LOTUS | LTS0121521 |
| wikiData | Q104916656 |