8-(4-Hydroxy-3-methoxyphenyl)-3-methoxy-6,7-dimethylnaphthalen-2-ol
| Internal ID | 11e3ad2f-ab3a-4dca-89a1-a770deb89914 |
| Taxonomy | Lignans, neolignans and related compounds > Arylnaphthalene lignans |
| IUPAC Name | 8-(4-hydroxy-3-methoxyphenyl)-3-methoxy-6,7-dimethylnaphthalen-2-ol |
| SMILES (Canonical) | CC1=CC2=CC(=C(C=C2C(=C1C)C3=CC(=C(C=C3)O)OC)O)OC |
| SMILES (Isomeric) | CC1=CC2=CC(=C(C=C2C(=C1C)C3=CC(=C(C=C3)O)OC)O)OC |
| InChI | InChI=1S/C20H20O4/c1-11-7-14-9-19(24-4)17(22)10-15(14)20(12(11)2)13-5-6-16(21)18(8-13)23-3/h5-10,21-22H,1-4H3 |
| InChI Key | UZQGODFKIYWCJR-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.13615911 g/mol |
| Topological Polar Surface Area (TPSA) | 58.90 Ų |
| XlogP | 4.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 96.51% | 99.15% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.49% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.04% | 94.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 90.26% | 93.31% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 89.45% | 88.48% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.78% | 92.94% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 87.76% | 98.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.69% | 86.33% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.57% | 89.62% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.04% | 95.56% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 84.20% | 91.79% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 83.98% | 92.68% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.61% | 92.62% |
| CHEMBL3085 | P43003 | Excitatory amino acid transporter 1 | 82.93% | 94.67% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.87% | 98.95% |
| CHEMBL4355 | O14976 | Serine/threonine-protein kinase GAK | 82.81% | 89.32% |
| CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 82.69% | 95.70% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 82.37% | 91.49% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.22% | 99.17% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.09% | 93.65% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 80.00% | 95.48% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Knema furfuracea |
| PubChem | 14534886 |
| LOTUS | LTS0055043 |
| wikiData | Q105282400 |